3,3-Difluoro-1,1,1,3-tetrachloropropan-2-one structure
|
Common Name | 3,3-Difluoro-1,1,1,3-tetrachloropropan-2-one | ||
|---|---|---|---|---|
| CAS Number | 758-41-8 | Molecular Weight | 231.84000 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C3Cl4F2O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 1,1,1,3-tetrachloro-3,3-difluoropropan-2-one |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C3Cl4F2O |
|---|---|
| Molecular Weight | 231.84000 |
| Exact Mass | 229.86700 |
| PSA | 17.07000 |
| LogP | 2.75730 |
| InChIKey | CNENXGSNYTUVDC-UHFFFAOYSA-N |
| SMILES | O=C(C(F)(F)Cl)C(Cl)(Cl)Cl |
|
~%
3,3-Difluoro-1,... CAS#:758-41-8 |
| Literature: Abel,E.W. et al. Journal of the Chemical Society [Section] A: Inorganic, Physical, Theoretical, 1971 , p. 1991 - 1993 |
|
~%
3,3-Difluoro-1,... CAS#:758-41-8 |
| Literature: Allied Chem. and Dye Corp. Patent: US2853524 , 1955 ; |
| 1,1,1,3-Tetrachlor-3,3-difluoraceton |
| 1.1-Difluor-1.3.3.3-tetrachloraceton |
| 3,3-DIFLUORO-1,1,1,3-TETRACHLOROPROPAN-2-ONE |
| tetrachlorodifluoroacetone |
| 1,1,1,3-tetrachloro-3,3-difluoro-propan-2-one |
| Tetrachlor-1,1-difluor-aceton |
| Difluor-tetrachloraceton |
| tetrachloro-1,1-difluoro-acetone |