Perfluor-N-methyl-N,N-diethylamine
Perfluor-N-methyl-N,N-diethylamine structure
|
Common Name | Perfluor-N-methyl-N,N-diethylamine | ||
|---|---|---|---|---|
| CAS Number | 758-48-5 | Molecular Weight | 321.03900 | |
| Density | 1.695g/cm3 | Boiling Point | 45.2ºC at 760 mmHg | |
| Molecular Formula | C5F13N | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Summary: Perfluor-N-methyl-N,N-diethylamine (Chinese name: 1,1,2,2,2-五氟乙基-1,1,2,2,2-五氟乙基-N-三氟甲基-N-甲基乙基胺), CAS number: 758-48-5, molecular formula: C5F13N, molecular weight: 321.04, for research-use only, not for medical or clinical usage.
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | Ethanamine, 1,1,2,2,2-pentafluoro-N-(1,1,2,2,2-pentafluoroethyl)-N-(trifluoromethyl) |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Density | 1.695g/cm3 |
|---|---|
| Boiling Point | 45.2ºC at 760 mmHg |
| Molecular Formula | C5F13N |
| Molecular Weight | 321.03900 |
| Exact Mass | 320.98200 |
| PSA | 3.24000 |
| LogP | 4.11840 |
| Index of Refraction | 1.258 |
| InChIKey | KMPITNDOTGKQSE-UHFFFAOYSA-N |
| SMILES | FC(F)(F)N(C(F)(F)C(F)(F)F)C(F)(F)C(F)(F)F |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 10 | |
|---|---|
| DownStream 0 | |
CAS#:5351-01-9
CAS#:30280-35-4
CAS#:106815-18-3
CAS#:122-96-3
CAS#:33611-41-5
CAS#:103-76-4
CAS#:100-37-8
CAS#:5780-70-1
CAS#:121-44-8
CAS#:132917-41-0This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| Diethylamine, 1,1,1',1',2,2,2,2',2',2'-decafluoro-N-(trifluoromethyl)- (6CI,7CI,8CI) |
| Perfluorodiethylmethylamine |
| Bis(pentafluoroethyl)(trifluoromethyl)amine |
| Ethanamine, 1,1,2,2,2-pentafluoro-N-(pentafluoroethyl)-N-(trifluoromethyl)- (9CI) |
| Trifluoromethylbis(pentafluoroethyl)amine |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular weight of Ethanamine, 1,1,2,2,2-pentafluoro-N-(1,1,2,2,2-pentafluoroethyl)-N-(trifluoromethyl)? |
| A: Molecular weight of Ethanamine, 1,1,2,2,2-pentafluoro-N-(1,1,2,2,2-pentafluoroethyl)-N-(trifluoromethyl) is 321.03900. |
| Q: What is the molecular formula of Ethanamine, 1,1,2,2,2-pentafluoro-N-(1,1,2,2,2-pentafluoroethyl)-N-(trifluoromethyl)? |
| A: Molecular formula of Ethanamine, 1,1,2,2,2-pentafluoro-N-(1,1,2,2,2-pentafluoroethyl)-N-(trifluoromethyl) is C5F13N. |
| Q: What is the InChIKey of Ethanamine, 1,1,2,2,2-pentafluoro-N-(1,1,2,2,2-pentafluoroethyl)-N-(trifluoromethyl)? |
| A: InChIKey of Ethanamine, 1,1,2,2,2-pentafluoro-N-(1,1,2,2,2-pentafluoroethyl)-N-(trifluoromethyl) is KMPITNDOTGKQSE-UHFFFAOYSA-N. |
| Q: What is the English name of Ethanamine, 1,1,2,2,2-pentafluoro-N-(1,1,2,2,2-pentafluoroethyl)-N-(trifluoromethyl)? |
| A: The English name of Ethanamine, 1,1,2,2,2-pentafluoro-N-(1,1,2,2,2-pentafluoroethyl)-N-(trifluoromethyl) is Ethanamine, 1,1,2,2,2-pentafluoro-N-(1,1,2,2,2-pentafluoroethyl)-N-(trifluoromethyl). |
| Q: What is the CAS number of Ethanamine, 1,1,2,2,2-pentafluoro-N-(1,1,2,2,2-pentafluoroethyl)-N-(trifluoromethyl)? |
| A: CAS number of Ethanamine, 1,1,2,2,2-pentafluoro-N-(1,1,2,2,2-pentafluoroethyl)-N-(trifluoromethyl) is 758-48-5. |
| Q: What English synonyms does Ethanamine, 1,1,2,2,2-pentafluoro-N-(1,1,2,2,2-pentafluoroethyl)-N-(trifluoromethyl) have? |
| A: English synonyms of Ethanamine, 1,1,2,2,2-pentafluoro-N-(1,1,2,2,2-pentafluoroethyl)-N-(trifluoromethyl): Diethylamine, 1,1,1',1',2,2,2,2',2',2'-decafluoro-N-(trifluoromethyl)- (6CI,7CI,8CI), Perfluorodiethylmethylamine, Bis(pentafluoroethyl)(trifluoromethyl)amine, Ethanamine, 1,1,2,2,2-pentafluoro-N-(pentafluoroethyl)-N-(trifluoromethyl)- (9CI), Trifluoromethylbis(pentafluoroethyl)amine. |
| Q: What is the LogP of Ethanamine, 1,1,2,2,2-pentafluoro-N-(1,1,2,2,2-pentafluoroethyl)-N-(trifluoromethyl)? |
| A: LogP of Ethanamine, 1,1,2,2,2-pentafluoro-N-(1,1,2,2,2-pentafluoroethyl)-N-(trifluoromethyl) is 4.11840. |
| Q: What is the polar surface area (PSA) of Ethanamine, 1,1,2,2,2-pentafluoro-N-(1,1,2,2,2-pentafluoroethyl)-N-(trifluoromethyl)? |
| A: Polar surface area (PSA) of Ethanamine, 1,1,2,2,2-pentafluoro-N-(1,1,2,2,2-pentafluoroethyl)-N-(trifluoromethyl) is 3.24000. |
| Q: What are the upstream materials of Ethanamine, 1,1,2,2,2-pentafluoro-N-(1,1,2,2,2-pentafluoroethyl)-N-(trifluoromethyl)? |
| A: Related upstream materials(CAS) of Ethanamine, 1,1,2,2,2-pentafluoro-N-(1,1,2,2,2-pentafluoroethyl)-N-(trifluoromethyl): 5351-01-9;30280-35-4;106815-18-3;122-96-3;33611-41-5;103-76-4;100-37-8;5780-70-1;121-44-8;132917-41-0. |
| Q: What is the SMILES notation of Ethanamine, 1,1,2,2,2-pentafluoro-N-(1,1,2,2,2-pentafluoroethyl)-N-(trifluoromethyl)? |
| A: SMILES notation of Ethanamine, 1,1,2,2,2-pentafluoro-N-(1,1,2,2,2-pentafluoroethyl)-N-(trifluoromethyl) is FC(F)(F)N(C(F)(F)C(F)(F)F)C(F)(F)C(F)(F)F. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Dayang Chem (Hangzhou) Co., Ltd. |