2,2-dimethyl-5-(naphthalen-1-ylmethylidene)-1,3-dioxane-4,6-dione
2,2-dimethyl-5-(naphthalen-1-ylmethylidene)-1,3-dioxane-4,6-dione structure
|
Common Name | 2,2-dimethyl-5-(naphthalen-1-ylmethylidene)-1,3-dioxane-4,6-dione | ||
|---|---|---|---|---|
| CAS Number | 75804-52-3 | Molecular Weight | 282.29100 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C17H14O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Summary: 2,2-Dimethyl-5-(naphthalen-1-ylmethylene)-1,3-dioxane-4,6-dione, with a CAS number of 75804-52-3, has a molecular formula of C17H14O4 and a molecular weight of 282.29100. For research-use only, not for medical or clinical usage.
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 2,2-dimethyl-5-(naphthalen-1-ylmethylidene)-1,3-dioxane-4,6-dione |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C17H14O4 |
|---|---|
| Molecular Weight | 282.29100 |
| Exact Mass | 282.08900 |
| PSA | 52.60000 |
| LogP | 3.05930 |
| InChIKey | MTBTVQIKHNOSNR-UHFFFAOYSA-N |
| SMILES | CC1(C)OC(=O)C(=Cc2cccc3ccccc23)C(=O)O1 |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~92%
2,2-dimethyl-5-... CAS#:75804-52-3 |
| Literature: Dumas, Aaron M.; Seed, Adam; Zorzitto, Alexander K.; Fillion, Eric Tetrahedron Letters, 2007 , vol. 48, # 40 p. 7072 - 7074 |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 2 | |
|---|---|
| DownStream 1 | |
CAS#:13026-12-5This table contains target information, in‑vitro & in‑vivo assay data for this compound.
|
Name: Antioxidant activity assessed as ABTS free radical scavenging activity at 100 uM afte...
Source: ChEMBL
Target: NON-PROTEIN TARGET
External Id: CHEMBL1217291
|
|
Name: Antioxidant activity assessed as DPPH free radical scavenging activity at 100 uM afte...
Source: ChEMBL
Target: N/A
External Id: CHEMBL1217290
|
|
Name: Antimalarial activity against Plasmodium falciparum infected in human O+ erythrocytes...
Source: ChEMBL
Target: Plasmodium falciparum
External Id: CHEMBL1217289
|
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| isopropylidene 1-naphthylmethylenemalonate |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the SMILES notation of 2,2-dimethyl-5-(naphthalen-1-ylmethylidene)-1,3-dioxane-4,6-dione? |
| A: SMILES notation of 2,2-dimethyl-5-(naphthalen-1-ylmethylidene)-1,3-dioxane-4,6-dione is CC1(C)OC(=O)C(=Cc2cccc3ccccc23)C(=O)O1. |
| Q: What is the LogP of 2,2-dimethyl-5-(naphthalen-1-ylmethylidene)-1,3-dioxane-4,6-dione? |
| A: LogP of 2,2-dimethyl-5-(naphthalen-1-ylmethylidene)-1,3-dioxane-4,6-dione is 3.05930. |
| Q: What are the upstream materials of 2,2-dimethyl-5-(naphthalen-1-ylmethylidene)-1,3-dioxane-4,6-dione? |
| A: Related upstream materials(CAS) of 2,2-dimethyl-5-(naphthalen-1-ylmethylidene)-1,3-dioxane-4,6-dione: 2033-24-1;66-77-3. |
| Q: What is the English name of 2,2-dimethyl-5-(naphthalen-1-ylmethylidene)-1,3-dioxane-4,6-dione? |
| A: The English name of 2,2-dimethyl-5-(naphthalen-1-ylmethylidene)-1,3-dioxane-4,6-dione is 2,2-dimethyl-5-(naphthalen-1-ylmethylidene)-1,3-dioxane-4,6-dione. |
| Q: What is the Chinese name of 75804-52-3? |
| A: Chinese name of 75804-52-3 is 75804-52-3. |
| Q: What is the CAS number of 2,2-dimethyl-5-(naphthalen-1-ylmethylidene)-1,3-dioxane-4,6-dione? |
| A: CAS number of 2,2-dimethyl-5-(naphthalen-1-ylmethylidene)-1,3-dioxane-4,6-dione is 75804-52-3. |
| Q: What English synonyms does 2,2-dimethyl-5-(naphthalen-1-ylmethylidene)-1,3-dioxane-4,6-dione have? |
| A: English synonyms of 2,2-dimethyl-5-(naphthalen-1-ylmethylidene)-1,3-dioxane-4,6-dione: isopropylidene 1-naphthylmethylenemalonate. |
| Q: What is the molecular weight of 2,2-dimethyl-5-(naphthalen-1-ylmethylidene)-1,3-dioxane-4,6-dione? |
| A: Molecular weight of 2,2-dimethyl-5-(naphthalen-1-ylmethylidene)-1,3-dioxane-4,6-dione is 282.29100. |
| Q: What is the InChIKey of 2,2-dimethyl-5-(naphthalen-1-ylmethylidene)-1,3-dioxane-4,6-dione? |
| A: InChIKey of 2,2-dimethyl-5-(naphthalen-1-ylmethylidene)-1,3-dioxane-4,6-dione is MTBTVQIKHNOSNR-UHFFFAOYSA-N. |
| Q: What is the molecular formula of 2,2-dimethyl-5-(naphthalen-1-ylmethylidene)-1,3-dioxane-4,6-dione? |
| A: Molecular formula of 2,2-dimethyl-5-(naphthalen-1-ylmethylidene)-1,3-dioxane-4,6-dione is C17H14O4. |