1-[2-(4-chlorophenyl)-2-oxoethyl]indole-2,3-dione structure
|
Common Name | 1-[2-(4-chlorophenyl)-2-oxoethyl]indole-2,3-dione | ||
|---|---|---|---|---|
| CAS Number | 75822-38-7 | Molecular Weight | 299.70900 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C16H10ClNO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 1-[2-(4-chlorophenyl)-2-oxoethyl]indole-2,3-dione |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C16H10ClNO3 |
|---|---|
| Molecular Weight | 299.70900 |
| Exact Mass | 299.03500 |
| PSA | 54.45000 |
| LogP | 2.81720 |
| InChIKey | XZZXOUNMODASMA-UHFFFAOYSA-N |
| SMILES | O=C(CN1C(=O)C(=O)c2ccccc21)c1ccc(Cl)cc1 |
|
~71%
1-[2-(4-chlorop... CAS#:75822-38-7 |
| Literature: Rekhter Chemistry of Heterocyclic Compounds, 1999 , vol. 35, # 10 p. 1165 - 1166 |
|
~%
1-[2-(4-chlorop... CAS#:75822-38-7 |
| Literature: Shuttleworth, Stephen J.; Nasturica, Daniel; Gervais, Christian; Siddiqui, M. Arshad; Rando, Robert F.; Lee, Nola Bioorganic and Medicinal Chemistry Letters, 2000 , vol. 10, # 22 p. 2501 - 2504 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| ccg-9996 |
| hms2826m08 |