2-chloro-4-phenylmethoxybenzoic acid
2-chloro-4-phenylmethoxybenzoic acid structure
|
Common Name | 2-chloro-4-phenylmethoxybenzoic acid | ||
|---|---|---|---|---|
| CAS Number | 75835-35-7 | Molecular Weight | 262.68800 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C14H11ClO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Summary: 4-Benzoyloxy-2-chlorobenzoic acid (CAS number: 75835-35-7), molecular formula: C14H11ClO3, molecular weight: 262.68800. For research-use only, not for medical or clinical usage.
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 2-chloro-4-phenylmethoxybenzoic acid |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C14H11ClO3 |
|---|---|
| Molecular Weight | 262.68800 |
| Exact Mass | 262.04000 |
| PSA | 46.53000 |
| LogP | 3.61720 |
| InChIKey | NLSYAGPPJSQRGM-UHFFFAOYSA-N |
| SMILES | O=C(O)c1ccc(OCc2ccccc2)cc1Cl |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~%
2-chloro-4-phen... CAS#:75835-35-7 |
| Literature: Fujisawa Pharmaceutical Co., Ltd. Patent: US6348474 B1, 2002 ; Location in patent: Page column 110 ; |
|
~73%
2-chloro-4-phen... CAS#:75835-35-7 |
| Literature: Tighineanu, Elena; Chiraleu, Filip; Raileanu, Dan Tetrahedron, 1980 , vol. 36, p. 1385 - 1397 |
|
~%
2-chloro-4-phen... CAS#:75835-35-7 |
| Literature: FUJISAWA PHARMACEUTICAL CO., LTD. Patent: EP1142879 A1, 2001 ; |
|
~%
2-chloro-4-phen... CAS#:75835-35-7 |
| Literature: Drzewinski; Dabrowski; Czuprynski Polish Journal of Chemistry, 2002 , vol. 76, # 2-3 p. 273 - 284 |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 4 | |
|---|---|
| DownStream 0 | |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular weight of 2-chloro-4-phenylmethoxybenzoic acid? |
| A: Molecular weight of 2-chloro-4-phenylmethoxybenzoic acid is 262.68800. |
| Q: What is the InChIKey of 2-chloro-4-phenylmethoxybenzoic acid? |
| A: InChIKey of 2-chloro-4-phenylmethoxybenzoic acid is NLSYAGPPJSQRGM-UHFFFAOYSA-N. |
| Q: What is the SMILES notation of 2-chloro-4-phenylmethoxybenzoic acid? |
| A: SMILES notation of 2-chloro-4-phenylmethoxybenzoic acid is O=C(O)c1ccc(OCc2ccccc2)cc1Cl. |
| Q: What is the CAS number of 2-chloro-4-phenylmethoxybenzoic acid? |
| A: CAS number of 2-chloro-4-phenylmethoxybenzoic acid is 75835-35-7. |
| Q: What is the English name of 2-chloro-4-phenylmethoxybenzoic acid? |
| A: The English name of 2-chloro-4-phenylmethoxybenzoic acid is 2-chloro-4-phenylmethoxybenzoic acid. |
| Q: What is the polar surface area (PSA) of 2-chloro-4-phenylmethoxybenzoic acid? |
| A: Polar surface area (PSA) of 2-chloro-4-phenylmethoxybenzoic acid is 46.53000. |
| Q: What is the LogP of 2-chloro-4-phenylmethoxybenzoic acid? |
| A: LogP of 2-chloro-4-phenylmethoxybenzoic acid is 3.61720. |
| Q: What is the molecular formula of 2-chloro-4-phenylmethoxybenzoic acid? |
| A: Molecular formula of 2-chloro-4-phenylmethoxybenzoic acid is C14H11ClO3. |
| Q: What are the upstream materials of 2-chloro-4-phenylmethoxybenzoic acid? |
| A: Related upstream materials(CAS) of 2-chloro-4-phenylmethoxybenzoic acid: 56363-84-9;100-44-7;123-91-1;56069-35-3. |