N-(4-methylphenyl)-1,1-bis(2,3,4,5,6-pentafluorophenyl)methanimine structure
|
Common Name | N-(4-methylphenyl)-1,1-bis(2,3,4,5,6-pentafluorophenyl)methanimine | ||
|---|---|---|---|---|
| CAS Number | 75840-65-2 | Molecular Weight | 451.26000 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C20H7F10N | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | N-(4-methylphenyl)-1,1-bis(2,3,4,5,6-pentafluorophenyl)methanimine |
|---|
| Molecular Formula | C20H7F10N |
|---|---|
| Molecular Weight | 451.26000 |
| Exact Mass | 451.04200 |
| PSA | 12.36000 |
| LogP | 6.55510 |
| InChIKey | JVSYTJFLGCQNPR-UHFFFAOYSA-N |
| SMILES | Cc1ccc(N=C(c2c(F)c(F)c(F)c(F)c2F)c2c(F)c(F)c(F)c(F)c2F)cc1 |
|
~34%
N-(4-methylphen... CAS#:75840-65-2 |
| Literature: Danilenko, N. I.; Fomenko, T. V.; Korobeinicheva, I. K.; Gerasimova, T. N.; Fokin, E. P. Bulletin of the Academy of Sciences of the USSR, Division of Chemical Science (English Translation), 1980 , vol. 29, # 7 p. 1149 - 1154 Izvestiya Akademii Nauk SSSR, Seriya Khimicheskaya, 1980 , # 7 p. 1606 - 1611 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |