N-(4-methylphenyl)-1,1-bis(2,3,4,5,6-pentafluorophenyl)methanimine
N-(4-methylphenyl)-1,1-bis(2,3,4,5,6-pentafluorophenyl)methanimine structure
|
Common Name | N-(4-methylphenyl)-1,1-bis(2,3,4,5,6-pentafluorophenyl)methanimine | ||
|---|---|---|---|---|
| CAS Number | 75840-65-2 | Molecular Weight | 451.26000 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C20H7F10N | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Summary: N-(4-methylphenyl)-1,1-bis(2,3,4,5,6-pentafluorophenyl)methanimine, Chinese name not provided, CAS number 75840-65-2, molecular formula C20H7F10N, molecular weight 451.26000. For research-use only, not for medical or clinical usage.
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | N-(4-methylphenyl)-1,1-bis(2,3,4,5,6-pentafluorophenyl)methanimine |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C20H7F10N |
|---|---|
| Molecular Weight | 451.26000 |
| Exact Mass | 451.04200 |
| PSA | 12.36000 |
| LogP | 6.55510 |
| InChIKey | JVSYTJFLGCQNPR-UHFFFAOYSA-N |
| SMILES | Cc1ccc(N=C(c2c(F)c(F)c(F)c(F)c2F)c2c(F)c(F)c(F)c(F)c2F)cc1 |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~34%
N-(4-methylphen... CAS#:75840-65-2 |
| Literature: Danilenko, N. I.; Fomenko, T. V.; Korobeinicheva, I. K.; Gerasimova, T. N.; Fokin, E. P. Bulletin of the Academy of Sciences of the USSR, Division of Chemical Science (English Translation), 1980 , vol. 29, # 7 p. 1149 - 1154 Izvestiya Akademii Nauk SSSR, Seriya Khimicheskaya, 1980 , # 7 p. 1606 - 1611 |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 2 | |
|---|---|
| DownStream 0 | |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the CAS number of N-(4-methylphenyl)-1,1-bis(2,3,4,5,6-pentafluorophenyl)methanimine? |
| A: CAS number of N-(4-methylphenyl)-1,1-bis(2,3,4,5,6-pentafluorophenyl)methanimine is 75840-65-2. |
| Q: What is the polar surface area (PSA) of N-(4-methylphenyl)-1,1-bis(2,3,4,5,6-pentafluorophenyl)methanimine? |
| A: Polar surface area (PSA) of N-(4-methylphenyl)-1,1-bis(2,3,4,5,6-pentafluorophenyl)methanimine is 12.36000. |
| Q: What is the Chinese name of 75840-65-2? |
| A: Chinese name of 75840-65-2 is 75840-65-2. |
| Q: What is the molecular weight of N-(4-methylphenyl)-1,1-bis(2,3,4,5,6-pentafluorophenyl)methanimine? |
| A: Molecular weight of N-(4-methylphenyl)-1,1-bis(2,3,4,5,6-pentafluorophenyl)methanimine is 451.26000. |
| Q: What are the upstream materials of N-(4-methylphenyl)-1,1-bis(2,3,4,5,6-pentafluorophenyl)methanimine? |
| A: Related upstream materials(CAS) of N-(4-methylphenyl)-1,1-bis(2,3,4,5,6-pentafluorophenyl)methanimine: 853-39-4;106-49-0. |
| Q: What is the molecular formula of N-(4-methylphenyl)-1,1-bis(2,3,4,5,6-pentafluorophenyl)methanimine? |
| A: Molecular formula of N-(4-methylphenyl)-1,1-bis(2,3,4,5,6-pentafluorophenyl)methanimine is C20H7F10N. |
| Q: What is the English name of N-(4-methylphenyl)-1,1-bis(2,3,4,5,6-pentafluorophenyl)methanimine? |
| A: The English name of N-(4-methylphenyl)-1,1-bis(2,3,4,5,6-pentafluorophenyl)methanimine is N-(4-methylphenyl)-1,1-bis(2,3,4,5,6-pentafluorophenyl)methanimine. |
| Q: What is the LogP of N-(4-methylphenyl)-1,1-bis(2,3,4,5,6-pentafluorophenyl)methanimine? |
| A: LogP of N-(4-methylphenyl)-1,1-bis(2,3,4,5,6-pentafluorophenyl)methanimine is 6.55510. |
| Q: What is the SMILES notation of N-(4-methylphenyl)-1,1-bis(2,3,4,5,6-pentafluorophenyl)methanimine? |
| A: SMILES notation of N-(4-methylphenyl)-1,1-bis(2,3,4,5,6-pentafluorophenyl)methanimine is Cc1ccc(N=C(c2c(F)c(F)c(F)c(F)c2F)c2c(F)c(F)c(F)c(F)c2F)cc1. |
| Q: What is the InChIKey of N-(4-methylphenyl)-1,1-bis(2,3,4,5,6-pentafluorophenyl)methanimine? |
| A: InChIKey of N-(4-methylphenyl)-1,1-bis(2,3,4,5,6-pentafluorophenyl)methanimine is JVSYTJFLGCQNPR-UHFFFAOYSA-N. |