5-Amino-3-biphenylacetic acid
Modify Date: 2026-03-06 00:51:17
5-Amino-3-biphenylacetic acid structure
|
Common Name | 5-Amino-3-biphenylacetic acid | ||
|---|---|---|---|---|
| CAS Number | 75852-46-9 | Molecular Weight | 227.25900 | |
| Density | 1.232g/cm3 | Boiling Point | 462ºC at 760 mmHg | |
| Molecular Formula | C14H13NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 233.2ºC | |
| Name | 2-(3-amino-5-phenylphenyl)acetic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.232g/cm3 |
|---|---|
| Boiling Point | 462ºC at 760 mmHg |
| Molecular Formula | C14H13NO2 |
| Molecular Weight | 227.25900 |
| Flash Point | 233.2ºC |
| Exact Mass | 227.09500 |
| PSA | 63.32000 |
| LogP | 3.14410 |
| Index of Refraction | 1.636 |
| InChIKey | HROOQWGZDYRPIN-UHFFFAOYSA-N |
| SMILES | Nc1cc(CC(=O)O)cc(-c2ccccc2)c1 |
|
~%
5-Amino-3-biphe... CAS#:75852-46-9 |
| Literature: Tamura, Yasumitsu; Yoshimoto, Yoshihiko; Kunimoto, Katsutoshi; Tada, Shin-ichi; Matsumura, Shingo; et al. Journal of Medicinal Chemistry, 1981 , vol. 24, # 1 p. 43 - 47 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| 3-BIPHENYLACETIC ACID,5-AMINO |
| 5-Amino-3-biphenylacetic acid |