3-[4-methoxy-6-[2-(1-piperidyl)ethoxy]benzofuran-5-yl]-1-methyl-urea structure
|
Common Name | 3-[4-methoxy-6-[2-(1-piperidyl)ethoxy]benzofuran-5-yl]-1-methyl-urea | ||
|---|---|---|---|---|
| CAS Number | 75902-76-0 | Molecular Weight | 347.40900 | |
| Density | 1.213g/cm3 | Boiling Point | 496ºC at 760 mmHg | |
| Molecular Formula | C18H25N3O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 1-[4-methoxy-6-(2-piperidin-1-ylethoxy)-1-benzofuran-5-yl]-3-methylurea |
|---|
| Density | 1.213g/cm3 |
|---|---|
| Boiling Point | 496ºC at 760 mmHg |
| Molecular Formula | C18H25N3O4 |
| Molecular Weight | 347.40900 |
| Exact Mass | 347.18500 |
| PSA | 79.46000 |
| LogP | 3.27270 |
| Index of Refraction | 1.592 |
| InChIKey | RDXJXBXQSILRIE-UHFFFAOYSA-N |
| SMILES | CNC(=O)Nc1c(OCCN2CCCCC2)cc2occc2c1OC |
| HS Code | 2934999090 |
|---|
|
~59%
3-[4-methoxy-6-... CAS#:75902-76-0 |
| Literature: Bourgery, Guy; Dostert, Philippe; Lacour, Alain; Langlois, Michel; Pourrias, Bernard; Tisne-Versailles, Jacky Journal of Medicinal Chemistry, 1981 , vol. 24, # 2 p. 159 - 167 |
|
~%
3-[4-methoxy-6-... CAS#:75902-76-0 |
| Literature: Bourgery, Guy; Dostert, Philippe; Lacour, Alain; Langlois, Michel; Pourrias, Bernard; Tisne-Versailles, Jacky Journal of Medicinal Chemistry, 1981 , vol. 24, # 2 p. 159 - 167 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| HS Code | 2934999090 |
|---|---|
| Summary | 2934999090. other heterocyclic compounds. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |