2-ethyl-3-prop-2-enyl-naphthalene-1,4-dione structure
|
Common Name | 2-ethyl-3-prop-2-enyl-naphthalene-1,4-dione | ||
|---|---|---|---|---|
| CAS Number | 75909-63-6 | Molecular Weight | 226.27000 | |
| Density | 1.102g/cm3 | Boiling Point | 353.1ºC at 760 mmHg | |
| Molecular Formula | C15H14O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 132.5ºC | |
| Name | 2-ethyl-3-prop-2-enylnaphthalene-1,4-dione |
|---|---|
| Synonym | More Synonyms |
| Density | 1.102g/cm3 |
|---|---|
| Boiling Point | 353.1ºC at 760 mmHg |
| Molecular Formula | C15H14O2 |
| Molecular Weight | 226.27000 |
| Flash Point | 132.5ºC |
| Exact Mass | 226.09900 |
| PSA | 34.14000 |
| LogP | 3.34830 |
| Index of Refraction | 1.555 |
| InChIKey | BZVSCOJVRSDRDH-UHFFFAOYSA-N |
| SMILES | C=CCC1=C(CC)C(=O)c2ccccc2C1=O |
|
~%
2-ethyl-3-prop-... CAS#:75909-63-6 |
| Literature: Liebeskind, Lanny S.; Baysdom, Sherrol L.; South, Mivhael S. Journal of the American Chemical Society, 1980 , vol. 102, # 24 p. 7397 - 7398 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 2-Allyl-3-ethyl-1,4-naphthochinon |
| 2-ethyl-3-(3-propenyl)-1,4-naphthoquinone |