3-ethyl-2-methyl-7-nitro-1H-indole structure
|
Common Name | 3-ethyl-2-methyl-7-nitro-1H-indole | ||
|---|---|---|---|---|
| CAS Number | 7595-71-3 | Molecular Weight | 204.22500 | |
| Density | 1.254g/cm3 | Boiling Point | 384.5ºC at 760 mmHg | |
| Molecular Formula | C11H12N2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 186.3ºC | |
| Name | 3-ethyl-2-methyl-7-nitro-1H-indole |
|---|---|
| Synonym | More Synonyms |
| Density | 1.254g/cm3 |
|---|---|
| Boiling Point | 384.5ºC at 760 mmHg |
| Molecular Formula | C11H12N2O2 |
| Molecular Weight | 204.22500 |
| Flash Point | 186.3ºC |
| Exact Mass | 204.09000 |
| PSA | 61.61000 |
| LogP | 3.47010 |
| Index of Refraction | 1.65 |
| InChIKey | IGTRZDVDURLEHH-UHFFFAOYSA-N |
| SMILES | CCc1c(C)[nH]c2c([N+](=O)[O-])cccc12 |
|
~%
3-ethyl-2-methy... CAS#:7595-71-3 |
| Literature: Schofield; Theobald Journal of the Chemical Society, 1950 , p. 1505,1508 |
| 2-methyl-3-ethyl-7-nitroindole |
| 7-Nitro-2-methyl-3-aethyl-indol |
| 3-Aethyl-2-methyl-7-nitro-indol |
| 3-ethyl-2-methyl-7-nitro-indole |