2-Butene-1,4-diaminium,N1,N1,N1,N4,N4,N4-hexamethyl-, chloride (1:2) structure
|
Common Name | 2-Butene-1,4-diaminium,N1,N1,N1,N4,N4,N4-hexamethyl-, chloride (1:2) | ||
|---|---|---|---|---|
| CAS Number | 7596-31-8 | Molecular Weight | 208.77200 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C10H25ClN2++ | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | trimethyl-[(E)-4-(trimethylazaniumyl)but-2-enyl]azanium,hydrochloride |
|---|
| Molecular Formula | C10H25ClN2++ |
|---|---|
| Molecular Weight | 208.77200 |
| Exact Mass | 208.17100 |
| LogP | 1.75700 |
| InChIKey | PWUQOCOONDNFBP-USRGLUTNSA-N |
| SMILES | C[N+](C)(C)CC=CC[N+](C)(C)C.Cl |
|
~%
2-Butene-1,4-di... CAS#:7596-31-8 |
| Literature: Niemer,Kohler Hoppe-Seyler's Zeitschrift fuer Physiologische Chemie, 1954 , vol. 296, p. 204,206 Show Details Hurd; Ensor Journal of the American Chemical Society, 1950 , vol. 72, p. 5135 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |