N-(4-amino-2-methyl-quinolin-6-yl)hexanamide structure
|
Common Name | N-(4-amino-2-methyl-quinolin-6-yl)hexanamide | ||
|---|---|---|---|---|
| CAS Number | 7596-35-2 | Molecular Weight | 271.35700 | |
| Density | 1.157g/cm3 | Boiling Point | 524.8ºC at 760mmHg | |
| Molecular Formula | C16H21N3O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 271.2ºC | |
| Name | N-(4-amino-2-methylquinolin-6-yl)hexanamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.157g/cm3 |
|---|---|
| Boiling Point | 524.8ºC at 760mmHg |
| Molecular Formula | C16H21N3O |
| Molecular Weight | 271.35700 |
| Flash Point | 271.2ºC |
| Exact Mass | 271.16800 |
| PSA | 68.01000 |
| LogP | 4.29840 |
| InChIKey | KNDLDIPGHGDZMU-UHFFFAOYSA-N |
| SMILES | CCCCCC(=O)Nc1ccc2nc(C)cc(N)c2c1 |
|
~%
N-(4-amino-2-me... CAS#:7596-35-2 |
| Literature: Peng; Daniels Journal of the American Chemical Society, 1956 , vol. 78, p. 3703,3707 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| N-(4-AMINO-2-METHYL-(QUINOLIN-6-YL))HEXANAMIDE |
| N-(4-amino-2-methyl-[6]quinolyl)-hexanamide |
| N-(4-Amino-2-methyl-[6]chinolyl)-hexanamid |