Ethanol,2,2'-[(6,7-diphenyl-2,4-pteridinediyl)diimino]bis- (9CI) structure
|
Common Name | Ethanol,2,2'-[(6,7-diphenyl-2,4-pteridinediyl)diimino]bis- (9CI) | ||
|---|---|---|---|---|
| CAS Number | 7596-72-7 | Molecular Weight | 402.44900 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C22H22N6O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2-[[2-(2-hydroxyethylamino)-6,7-diphenylpteridin-4-yl]amino]ethanol |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C22H22N6O2 |
|---|---|
| Molecular Weight | 402.44900 |
| Exact Mass | 402.18000 |
| PSA | 116.08000 |
| LogP | 2.70820 |
| InChIKey | TZHWZFLFMFVPAV-UHFFFAOYSA-N |
| SMILES | OCCNc1nc(NCCO)c2nc(-c3ccccc3)c(-c3ccccc3)nc2n1 |
|
~%
Ethanol,2,2'-[(... CAS#:7596-72-7 |
| Literature: Taylor Journal of the American Chemical Society, 1952 , vol. 74, p. 1648 |
|
~%
Ethanol,2,2'-[(... CAS#:7596-72-7 |
| Literature: Taylor Journal of the American Chemical Society, 1952 , vol. 74, p. 1648 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| 2,2'-[(6,7-diphenylpteridine-2,4-diyl)diimino]diethanol |
| N2,N4-bis-(2-hydroxy-ethyl)-6,7-diphenyl-pteridine-2,4-diyldiamine |
| N2,N4-Bis-(2-hydroxy-aethyl)-6,7-diphenyl-pteridin-2,4-diyldiamin |
| 2,7-diphenylpteridine-2,4-diyl)bis(azanediyl)diethanol |