2(1H)-Quinolinone,7-chloro-4-[[4-(diethylamino)-1-methylbutyl]amino]- structure
|
Common Name | 2(1H)-Quinolinone,7-chloro-4-[[4-(diethylamino)-1-methylbutyl]amino]- | ||
|---|---|---|---|---|
| CAS Number | 7597-00-4 | Molecular Weight | 335.87200 | |
| Density | 1.15g/cm3 | Boiling Point | 498.8ºC at 760mmHg | |
| Molecular Formula | C18H26ClN3O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 255.5ºC | |
| Name | 7-chloro-4-[5-(diethylamino)pentan-2-ylamino]-1H-quinolin-2-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.15g/cm3 |
|---|---|
| Boiling Point | 498.8ºC at 760mmHg |
| Molecular Formula | C18H26ClN3O |
| Molecular Weight | 335.87200 |
| Flash Point | 255.5ºC |
| Exact Mass | 335.17600 |
| PSA | 48.13000 |
| LogP | 4.17690 |
| InChIKey | TXUZHSKEYRFSCA-UHFFFAOYSA-N |
| SMILES | CCN(CC)CCCC(C)Nc1cc(=O)[nH]c2cc(Cl)ccc12 |
|
~%
2(1H)-Quinolino... CAS#:7597-00-4 |
| Literature: Drake et al. Journal of the American Chemical Society, 1946 , vol. 68, p. 1208,1210 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| 7-Chlor-4-(4-diaethylamino-1-methyl-butylamino)-chinolin-2-ol |
| 7-chloro-4-(4-diethylamino-1-methyl-butylamino)-quinolin-2-ol |