2-Butanol,4-[(7-chloro-4-quinolinyl)amino]-1-(diethylamino)- structure
|
Common Name | 2-Butanol,4-[(7-chloro-4-quinolinyl)amino]-1-(diethylamino)- | ||
|---|---|---|---|---|
| CAS Number | 7597-07-1 | Molecular Weight | 321.84500 | |
| Density | 1.197g/cm3 | Boiling Point | 507.1ºC at 760mmHg | |
| Molecular Formula | C17H24ClN3O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 260.5ºC | |
| Name | 4-[(7-chloroquinolin-4-yl)amino]-1-(diethylamino)butan-2-ol |
|---|
| Density | 1.197g/cm3 |
|---|---|
| Boiling Point | 507.1ºC at 760mmHg |
| Molecular Formula | C17H24ClN3O |
| Molecular Weight | 321.84500 |
| Flash Point | 260.5ºC |
| Exact Mass | 321.16100 |
| PSA | 48.39000 |
| LogP | 3.46590 |
| InChIKey | ZUMBGWGMKFFGGB-UHFFFAOYSA-N |
| SMILES | CCN(CC)CC(O)CCNc1ccnc2cc(Cl)ccc12 |
|
~%
2-Butanol,4-[(7... CAS#:7597-07-1 |
| Literature: Drake et al. Journal of the American Chemical Society, 1946 , vol. 68, p. 1208,1210 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |