Propanoic acid,3-[(4-nitrophenyl)thio]
Modify Date: 2026-07-21 23:43:44
![Propanoic acid,3-[(4-nitrophenyl)thio] Structure](https://image.chemsrc.com/caspic/116/7597-45-7.png)
Propanoic acid,3-[(4-nitrophenyl)thio] structure
|
Common Name | Propanoic acid,3-[(4-nitrophenyl)thio] | ||
|---|---|---|---|---|
| CAS Number | 7597-45-7 | Molecular Weight | 227.23700 | |
| Density | 1.42g/cm3 | Boiling Point | 436.3ºC at 760mmHg | |
| Molecular Formula | C9H9NO4S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 217.6ºC | |
| Name | 3-(4-nitrophenyl)sulfanylpropanoic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.42g/cm3 |
|---|---|
| Boiling Point | 436.3ºC at 760mmHg |
| Molecular Formula | C9H9NO4S |
| Molecular Weight | 227.23700 |
| Flash Point | 217.6ºC |
| Exact Mass | 227.02500 |
| PSA | 108.42000 |
| LogP | 2.68480 |
| InChIKey | RUFCXXWAWDPCQV-UHFFFAOYSA-N |
| SMILES | O=C(O)CCSc1ccc([N+](=O)[O-])cc1 |
|
Name: qHTS screening for TAG (triacylglycerol) accumulators in algae
Source: 11812
Target: N/A
External Id: FATTTLab-Algae-Lipid
|
|
Name: Small-molecule inhibitors of ST2 (IL1RL1)
Source: 20881
Target: interleukin-1 receptor-like 1 isoform [homo sapiens]
External Id: ST2_IL33_Inhibitors_Primary_Screening_77700
|
|
Name: Alphascreen assay for small molecules abrogating mHTT-CaM Interaction
Source: 24983
Target: Huntingtin
External Id: KUHTS-Muma KU-CaM-Htt INH-01
|
Total 3, Current Page 1 of 1
1
| 3-(4-Nitro-phenylmercapto)-propionsaeure |
| 3-((4-nitrophenyl)thio)propanoic acid |
| 3-(4-nitro-phenylsulfanyl)-propionic acid |
| (2-Carboxy-ethyl)-(4-nitro-phenyl)-sulfid |
| 3-(4-nitrophenylsulfanyl)-propanoic acid |