2-chloro-1-(4-methylphenyl)sulfonyloxy-4-tert-butyl-benzene
Modify Date: 2026-07-03 10:19:15
2-chloro-1-(4-methylphenyl)sulfonyloxy-4-tert-butyl-benzene structure
|
Common Name | 2-chloro-1-(4-methylphenyl)sulfonyloxy-4-tert-butyl-benzene | ||
|---|---|---|---|---|
| CAS Number | 7598-31-4 | Molecular Weight | 338.84900 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C17H19ClO3S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | (4-tert-butyl-2-chlorophenyl) 4-methylbenzenesulfonate |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C17H19ClO3S |
|---|---|
| Molecular Weight | 338.84900 |
| Exact Mass | 338.07400 |
| PSA | 51.75000 |
| LogP | 5.79440 |
| InChIKey | WZDWXPXQTMRDPO-UHFFFAOYSA-N |
| SMILES | Cc1ccc(S(=O)(=O)Oc2ccc(C(C)(C)C)cc2Cl)cc1 |
|
~%
2-chloro-1-(4-m... CAS#:7598-31-4 |
| Literature: Sen; Roy Journal of the Indian Chemical Society, 1956 , vol. 33, p. 687 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| (4-tert-butyl-2-chlorophenyl)4-methylbenzenesulfonate |
| toluene-4-sulfonic acid-(4-tert-butyl-2-chloro-phenyl ester) |
| Toluol-4-sulfonsaeure-(4-tert-butyl-2-chlor-phenylester) |