2-methyl-3-(4-(3-pyridinylmethyl)phenyl)-2-propenoic acid structure
|
Common Name | 2-methyl-3-(4-(3-pyridinylmethyl)phenyl)-2-propenoic acid | ||
|---|---|---|---|---|
| CAS Number | 75987-08-5 | Molecular Weight | 253.29600 | |
| Density | 1.183g/cm3 | Boiling Point | 437.9ºC at 760 mmHg | |
| Molecular Formula | C16H15NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 218.6ºC | |
| Name | (E)-2-methyl-3-[4-(pyridin-3-ylmethyl)phenyl]prop-2-enoic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.183g/cm3 |
|---|---|
| Boiling Point | 437.9ºC at 760 mmHg |
| Molecular Formula | C16H15NO2 |
| Molecular Weight | 253.29600 |
| Flash Point | 218.6ºC |
| Exact Mass | 253.11000 |
| PSA | 50.19000 |
| LogP | 3.16030 |
| Index of Refraction | 1.624 |
| InChIKey | XMXMKWBRPQAPEB-FMIVXFBMSA-N |
| SMILES | CC(=Cc1ccc(Cc2cccnc2)cc1)C(=O)O |
| HS Code | 2933399090 |
|---|
| HS Code | 2933399090 |
|---|---|
| Summary | 2933399090. other compounds containing an unfused pyridine ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| Oky 1580 |
| Oky 1581 |