7-phenyl-4H-thieno[3,2-d]diazepine structure
|
Common Name | 7-phenyl-4H-thieno[3,2-d]diazepine | ||
|---|---|---|---|---|
| CAS Number | 75997-10-3 | Molecular Weight | 226.29700 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C13H10N2S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 7-phenyl-4H-thieno[3,2-d]diazepine |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C13H10N2S |
|---|---|
| Molecular Weight | 226.29700 |
| Exact Mass | 226.05600 |
| PSA | 52.96000 |
| LogP | 3.08320 |
| InChIKey | JLIVSYMADDPFKW-UHFFFAOYSA-N |
| SMILES | C1=C(c2ccccc2)N=NCc2ccsc21 |
|
~87%
7-phenyl-4H-thi... CAS#:75997-10-3 |
| Literature: Munro, David P.; Sharp, John T. Journal of the Chemical Society, Perkin Transactions 1: Organic and Bio-Organic Chemistry (1972-1999), 1980 , p. 1718 - 1723 |
| Precursor 0 | |
|---|---|
| DownStream 1 | |
| 4-phenyl-1H-thieno<2,3-d><1,2>diazepine |