Butanedioic acid,2,2,3,3-tetrahydroxy
Butanedioic acid,2,2,3,3-tetrahydroxy structure
|
Common Name | Butanedioic acid,2,2,3,3-tetrahydroxy | ||
|---|---|---|---|---|
| CAS Number | 76-30-2 | Molecular Weight | 182.08600 | |
| Density | 2.462g/cm3 | Boiling Point | 514.2ºC at 760 mmHg | |
| Molecular Formula | C4H6O8 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 278.9ºC | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 2,2,3,3-tetrahydroxybutanedioic acid |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Density | 2.462g/cm3 |
|---|---|
| Boiling Point | 514.2ºC at 760 mmHg |
| Molecular Formula | C4H6O8 |
| Molecular Weight | 182.08600 |
| Flash Point | 278.9ºC |
| Exact Mass | 182.00600 |
| PSA | 155.52000 |
| Index of Refraction | 1.738 |
| InChIKey | XHWHHMNORMIBBB-UHFFFAOYSA-N |
| SMILES | O=C(O)C(O)(O)C(O)(O)C(=O)O |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 10 | |
|---|---|
| DownStream 7 | |
CAS#:13171-63-6
CAS#:526-84-1
CAS#:87-69-4
CAS#:7732-18-5
CAS#:60-29-7
CAS#:120-80-9
CAS#:497-19-8
CAS#:109-95-5
CAS#:298-12-4
CAS#:99-50-3
CAS#:473-90-5
CAS#:80-69-3
CAS#:144-62-7
CAS#:461-72-3
CAS#:147-73-9
CAS#:133-37-9This table contains target information, in‑vitro & in‑vivo assay data for this compound.
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| Succinic acid,tetrahydroxy |
| Dioxytartaric acid |
| tetrahydroxy-butanedioic acid |
| Tetrahydroxy-bernsteinsaeure |
| Tartaric acid,dihydroxy |
| Dioxyweinsaeure |
| dihydroxytartaric Acid |
| Butanedioic acid,tetrahydroxy |
| TETRAHYDROXYSUCCINIC ACID |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What are the upstream materials of 2,2,3,3-tetrahydroxybutanedioic acid? |
| A: Related upstream materials(CAS) of 2,2,3,3-tetrahydroxybutanedioic acid: 13171-63-6;526-84-1;87-69-4;7732-18-5;60-29-7;120-80-9;497-19-8;109-95-5;298-12-4;99-50-3. |
| Q: What are the downstream products of 2,2,3,3-tetrahydroxybutanedioic acid? |
| A: Related downstream products(CAS) of 2,2,3,3-tetrahydroxybutanedioic acid: 473-90-5;80-69-3;144-62-7;298-12-4;461-72-3;147-73-9;133-37-9. |
| Q: What is the polar surface area (PSA) of 2,2,3,3-tetrahydroxybutanedioic acid? |
| A: Polar surface area (PSA) of 2,2,3,3-tetrahydroxybutanedioic acid is 155.52000. |
| Q: What is the InChIKey of 2,2,3,3-tetrahydroxybutanedioic acid? |
| A: InChIKey of 2,2,3,3-tetrahydroxybutanedioic acid is XHWHHMNORMIBBB-UHFFFAOYSA-N. |
| Q: What is the molecular weight of 2,2,3,3-tetrahydroxybutanedioic acid? |
| A: Molecular weight of 2,2,3,3-tetrahydroxybutanedioic acid is 182.08600. |
| Q: What is the SMILES notation of 2,2,3,3-tetrahydroxybutanedioic acid? |
| A: SMILES notation of 2,2,3,3-tetrahydroxybutanedioic acid is O=C(O)C(O)(O)C(O)(O)C(=O)O. |
| Q: What is the English name of 2,2,3,3-tetrahydroxybutanedioic acid? |
| A: The English name of 2,2,3,3-tetrahydroxybutanedioic acid is 2,2,3,3-tetrahydroxybutanedioic acid. |
| Q: What is the boiling point of 2,2,3,3-tetrahydroxybutanedioic acid? |
| A: Boiling point of 2,2,3,3-tetrahydroxybutanedioic acid is 514.2ºC at 760 mmHg. |
| Q: What is the molecular formula of 2,2,3,3-tetrahydroxybutanedioic acid? |
| A: Molecular formula of 2,2,3,3-tetrahydroxybutanedioic acid is C4H6O8. |
| Q: What is the CAS number of 2,2,3,3-tetrahydroxybutanedioic acid? |
| A: CAS number of 2,2,3,3-tetrahydroxybutanedioic acid is 76-30-2. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Dayang Chem (Hangzhou) Co., Ltd. |