Topicaine structure
|
Common Name | Topicaine | ||
|---|---|---|---|---|
| CAS Number | 76-91-5 | Molecular Weight | 307.42800 | |
| Density | 1g/cm3 | Boiling Point | 409.1ºC at 760 mmHg | |
| Molecular Formula | C18H29NO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 201.2ºC | |
| Name | 3-(diethylamino)propyl 4-butoxybenzoate |
|---|---|
| Synonym | More Synonyms |
| Density | 1g/cm3 |
|---|---|
| Boiling Point | 409.1ºC at 760 mmHg |
| Molecular Formula | C18H29NO3 |
| Molecular Weight | 307.42800 |
| Flash Point | 201.2ºC |
| Exact Mass | 307.21500 |
| PSA | 38.77000 |
| LogP | 3.75420 |
| Index of Refraction | 1.498 |
| InChIKey | VTQHDICZORLCQT-UHFFFAOYSA-N |
| SMILES | CCCCCCOc1ccc(C(O)(C(=O)OCCN(CC)CC)c2ccccc2)cc1 |
|
~%
Topicaine CAS#:76-91-5 |
| Literature: Bockstahler; Wright Journal of the American Chemical Society, 1949 , vol. 71, p. 3760,3761 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| 3-Diethylaminopropyl p-butoxybenzoate |
| 3-diethylaminopropyl 4-butoxybenzoate |
| TOPICAINE |
| UNII-AVX3SBZ79N |