Topicaine
Topicaine structure
|
Common Name | Topicaine | ||
|---|---|---|---|---|
| CAS Number | 76-91-5 | Molecular Weight | 427.6 | |
| Density | 1g/cm3 | Boiling Point | 409.1ºC at 760 mmHg | |
| Molecular Formula | C26H37NO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 201.2ºC | |
Summary: 3-(diethylamino)propyl 4-butoxybenzoate (Topicaine, CAS: 76-91-5), molecular formula C26H37NO4, molecular weight 427.6. For research-use only, not for medical or clinical usage.
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 3-(diethylamino)propyl 4-butoxybenzoate |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Density | 1g/cm3 |
|---|---|
| Boiling Point | 409.1ºC at 760 mmHg |
| Molecular Formula | C26H37NO4 |
| Molecular Weight | 427.6 |
| Flash Point | 201.2ºC |
| Exact Mass | 427.27225866 |
| PSA | 38.77000 |
| LogP | 3.75420 |
| Index of Refraction | 1.498 |
| InChIKey | VTQHDICZORLCQT-UHFFFAOYSA-N |
| SMILES | CCCCCCOC1=CC=C(C=C1)C(C2=CC=CC=C2)(C(=O)OCCN(CC)CC)O |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~%
Topicaine CAS#:76-91-5 |
| Literature: Bockstahler; Wright Journal of the American Chemical Society, 1949 , vol. 71, p. 3760,3761 |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 1 | |
|---|---|
| DownStream 0 | |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| 3-Diethylaminopropyl p-butoxybenzoate |
| 3-diethylaminopropyl 4-butoxybenzoate |
| TOPICAINE |
| UNII-AVX3SBZ79N |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the boiling point of 3-(diethylamino)propyl 4-butoxybenzoate? |
| A: Boiling point of 3-(diethylamino)propyl 4-butoxybenzoate is 409.1ºC at 760 mmHg. |
| Q: What English synonyms does 3-(diethylamino)propyl 4-butoxybenzoate have? |
| A: English synonyms of 3-(diethylamino)propyl 4-butoxybenzoate: 3-Diethylaminopropyl p-butoxybenzoate, 3-diethylaminopropyl 4-butoxybenzoate, TOPICAINE, UNII-AVX3SBZ79N. |
| Q: What is the LogP of 3-(diethylamino)propyl 4-butoxybenzoate? |
| A: LogP of 3-(diethylamino)propyl 4-butoxybenzoate is 3.75420. |
| Q: What is the SMILES notation of 3-(diethylamino)propyl 4-butoxybenzoate? |
| A: SMILES notation of 3-(diethylamino)propyl 4-butoxybenzoate is CCCCCCOC1=CC=C(C=C1)C(C2=CC=CC=C2)(C(=O)OCCN(CC)CC)O. |
| Q: What is the Chinese name of 76-91-5? |
| A: Chinese name of 76-91-5 is 76-91-5. |
| Q: What is the CAS number of 3-(diethylamino)propyl 4-butoxybenzoate? |
| A: CAS number of 3-(diethylamino)propyl 4-butoxybenzoate is 76-91-5. |
| Q: What is the polar surface area (PSA) of 3-(diethylamino)propyl 4-butoxybenzoate? |
| A: Polar surface area (PSA) of 3-(diethylamino)propyl 4-butoxybenzoate is 38.77000. |
| Q: What is the English name of 3-(diethylamino)propyl 4-butoxybenzoate? |
| A: The English name of 3-(diethylamino)propyl 4-butoxybenzoate is 3-(diethylamino)propyl 4-butoxybenzoate. |
| Q: What is the molecular weight of 3-(diethylamino)propyl 4-butoxybenzoate? |
| A: Molecular weight of 3-(diethylamino)propyl 4-butoxybenzoate is 427.6. |
| Q: What is the molecular formula of 3-(diethylamino)propyl 4-butoxybenzoate? |
| A: Molecular formula of 3-(diethylamino)propyl 4-butoxybenzoate is C26H37NO4. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Dayang Chem (Hangzhou) Co., Ltd. |