1-BOC-2-METHYL-3-OXOPIPERAZINE structure
|
Common Name | 1-BOC-2-METHYL-3-OXOPIPERAZINE | ||
|---|---|---|---|---|
| CAS Number | 76003-30-0 | Molecular Weight | 214.26200 | |
| Density | 1.086g/cm3 | Boiling Point | 362ºC at 760 mmHg | |
| Molecular Formula | C10H18N2O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 172.7ºC | |
| Name | Tert-butyl 2-methyl-3-oxopiperazine-1-carboxylate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.086g/cm3 |
|---|---|
| Boiling Point | 362ºC at 760 mmHg |
| Molecular Formula | C10H18N2O3 |
| Molecular Weight | 214.26200 |
| Flash Point | 172.7ºC |
| Exact Mass | 214.13200 |
| PSA | 58.64000 |
| LogP | 1.00850 |
| Index of Refraction | 1.469 |
| InChIKey | KKVKQTLLEBWZTR-UHFFFAOYSA-N |
| SMILES | CC1C(=O)NCCN1C(=O)OC(C)(C)C |
| HS Code | 2933599090 |
|---|
|
~99%
1-BOC-2-METHYL-... CAS#:76003-30-0 |
| Literature: Aebi, Johannes; Binggeli, Alfred; Green, Luke; Hartmann, Guido; Maerki, Hans P.; Mattei, Patrizio; Ricklin, Fabienne Patent: US2009/23713 A1, 2009 ; Location in patent: Page/Page column 16 ; US 20090023713 A1 |
|
~39%
1-BOC-2-METHYL-... CAS#:76003-30-0 |
| Literature: Kane, John M.; Carr, Albert A. Tetrahedron Letters, 1980 , vol. 21, p. 3019 - 3020 |
|
~%
1-BOC-2-METHYL-... CAS#:76003-30-0 |
| Literature: Tetrahedron Letters, , vol. 21, p. 3019 - 3020 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| HS Code | 2933599090 |
|---|---|
| Summary | 2933599090. other compounds containing a pyrimidine ring (whether or not hydrogenated) or piperazine ring in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| tert-butyl 2-methyl-3-oxopiperazine-1-carboxylate |