Benzenecarboximidamide,4-methyl-n-[1-(4-methylphenyl)-1-pentenyl]
Modify Date: 2025-09-28 21:39:27
![Benzenecarboximidamide,4-methyl-n-[1-(4-methylphenyl)-1-pentenyl] Structure](https://www.chemsrc.com/extcaspic/387/76005-96-4.png)
Benzenecarboximidamide,4-methyl-n-[1-(4-methylphenyl)-1-pentenyl] structure
|
Common Name | Benzenecarboximidamide,4-methyl-n-[1-(4-methylphenyl)-1-pentenyl] | ||
|---|---|---|---|---|
| CAS Number | 76005-96-4 | Molecular Weight | 292.4 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C20H24N2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | Benzenecarboximidamide,4-methyl-n-[1-(4-methylphenyl)-1-pentenyl] |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C20H24N2 |
|---|---|
| Molecular Weight | 292.4 |
| InChIKey | CXMTVZQQMACZDX-KPSZGOFPSA-N |
| SMILES | CCCC=C(N=C(N)c1ccc(C)cc1)c1ccc(C)cc1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular weight of Benzenecarboximidamide,4-methyl-n-[1-(4-methylphenyl)-1-pentenyl]? |
| A: Molecular weight of Benzenecarboximidamide,4-methyl-n-[1-(4-methylphenyl)-1-pentenyl] is 292.4. |
| Q: What is the SMILES notation of Benzenecarboximidamide,4-methyl-n-[1-(4-methylphenyl)-1-pentenyl]? |
| A: SMILES notation of Benzenecarboximidamide,4-methyl-n-[1-(4-methylphenyl)-1-pentenyl] is CCCC=C(N=C(N)c1ccc(C)cc1)c1ccc(C)cc1. |
| Q: What is the InChIKey of Benzenecarboximidamide,4-methyl-n-[1-(4-methylphenyl)-1-pentenyl]? |
| A: InChIKey of Benzenecarboximidamide,4-methyl-n-[1-(4-methylphenyl)-1-pentenyl] is CXMTVZQQMACZDX-KPSZGOFPSA-N. |
| Q: What is the English name of Benzenecarboximidamide,4-methyl-n-[1-(4-methylphenyl)-1-pentenyl]? |
| A: The English name of Benzenecarboximidamide,4-methyl-n-[1-(4-methylphenyl)-1-pentenyl] is Benzenecarboximidamide,4-methyl-n-[1-(4-methylphenyl)-1-pentenyl]. |
| Q: What is the molecular formula of Benzenecarboximidamide,4-methyl-n-[1-(4-methylphenyl)-1-pentenyl]? |
| A: Molecular formula of Benzenecarboximidamide,4-methyl-n-[1-(4-methylphenyl)-1-pentenyl] is C20H24N2. |
| Q: What is the Chinese name of 76005-96-4? |
| A: Chinese name of 76005-96-4 is 76005-96-4. |
| Q: What is the CAS number of Benzenecarboximidamide,4-methyl-n-[1-(4-methylphenyl)-1-pentenyl]? |
| A: CAS number of Benzenecarboximidamide,4-methyl-n-[1-(4-methylphenyl)-1-pentenyl] is 76005-96-4. |