5-Acetamido-4-hydroxy-3-((4-octylphenyl)diazenyl)naphthalene-2,7-disulfonic acid
Modify Date: 2026-07-29 20:08:53
5-Acetamido-4-hydroxy-3-((4-octylphenyl)diazenyl)naphthalene-2,7-disulfonic acid structure
|
Common Name | 5-Acetamido-4-hydroxy-3-((4-octylphenyl)diazenyl)naphthalene-2,7-disulfonic acid | ||
|---|---|---|---|---|
| CAS Number | 760138-05-4 | Molecular Weight | 577.7 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C26H31N3O8S2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 5-Acetamido-4-hydroxy-3-((4-octylphenyl)diazenyl)naphthalene-2,7-disulfonic acid |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C26H31N3O8S2 |
|---|---|
| Molecular Weight | 577.7 |
| InChIKey | AVXMNSVLHVULNH-UHFFFAOYSA-N |
| SMILES | CCCCCCCCc1ccc(N=Nc2c(S(=O)(=O)O)cc3cc(S(=O)(=O)O)cc(NC(C)=O)c3c2O)cc1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the CAS number of 5-Acetamido-4-hydroxy-3-((4-octylphenyl)diazenyl)naphthalene-2,7-disulfonic acid? |
| A: CAS number of 5-Acetamido-4-hydroxy-3-((4-octylphenyl)diazenyl)naphthalene-2,7-disulfonic acid is 760138-05-4. |
| Q: What is the Chinese name of 760138-05-4? |
| A: Chinese name of 760138-05-4 is 760138-05-4. |
| Q: What is the SMILES notation of 5-Acetamido-4-hydroxy-3-((4-octylphenyl)diazenyl)naphthalene-2,7-disulfonic acid? |
| A: SMILES notation of 5-Acetamido-4-hydroxy-3-((4-octylphenyl)diazenyl)naphthalene-2,7-disulfonic acid is CCCCCCCCc1ccc(N=Nc2c(S(=O)(=O)O)cc3cc(S(=O)(=O)O)cc(NC(C)=O)c3c2O)cc1. |
| Q: What is the InChIKey of 5-Acetamido-4-hydroxy-3-((4-octylphenyl)diazenyl)naphthalene-2,7-disulfonic acid? |
| A: InChIKey of 5-Acetamido-4-hydroxy-3-((4-octylphenyl)diazenyl)naphthalene-2,7-disulfonic acid is AVXMNSVLHVULNH-UHFFFAOYSA-N. |
| Q: What is the molecular weight of 5-Acetamido-4-hydroxy-3-((4-octylphenyl)diazenyl)naphthalene-2,7-disulfonic acid? |
| A: Molecular weight of 5-Acetamido-4-hydroxy-3-((4-octylphenyl)diazenyl)naphthalene-2,7-disulfonic acid is 577.7. |
| Q: What is the English name of 5-Acetamido-4-hydroxy-3-((4-octylphenyl)diazenyl)naphthalene-2,7-disulfonic acid? |
| A: The English name of 5-Acetamido-4-hydroxy-3-((4-octylphenyl)diazenyl)naphthalene-2,7-disulfonic acid is 5-Acetamido-4-hydroxy-3-((4-octylphenyl)diazenyl)naphthalene-2,7-disulfonic acid. |
| Q: What is the molecular formula of 5-Acetamido-4-hydroxy-3-((4-octylphenyl)diazenyl)naphthalene-2,7-disulfonic acid? |
| A: Molecular formula of 5-Acetamido-4-hydroxy-3-((4-octylphenyl)diazenyl)naphthalene-2,7-disulfonic acid is C26H31N3O8S2. |