3-(benzenesulfonyl)-4-phenyl-1,2,5-oxadiazole structure
|
Common Name | 3-(benzenesulfonyl)-4-phenyl-1,2,5-oxadiazole | ||
|---|---|---|---|---|
| CAS Number | 76016-70-1 | Molecular Weight | 286.30600 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C14H10N2O3S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 3-(benzenesulfonyl)-4-phenyl-1,2,5-oxadiazole |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C14H10N2O3S |
|---|---|
| Molecular Weight | 286.30600 |
| Exact Mass | 286.04100 |
| PSA | 81.44000 |
| LogP | 3.65020 |
| InChIKey | OUVAQVRCZMBAKW-UHFFFAOYSA-N |
| SMILES | O=S(=O)(c1ccccc1)c1nonc1-c1ccccc1 |
|
~%
3-(benzenesulfo... CAS#:76016-70-1 |
| Literature: Calvino; Mortarini; Gasco; et al. European Journal of Medicinal Chemistry, 1980 , vol. 15, # 5 p. 485 - 487 |
|
~%
3-(benzenesulfo... CAS#:76016-70-1 |
| Literature: Calvino; Mortarini; Gasco; et al. European Journal of Medicinal Chemistry, 1980 , vol. 15, # 5 p. 485 - 487 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| 3-Phenylsulfonyl-4-phenylfurazan |
| 3-phenyl-4-phenylsulfonylfurazan |