9Kab6U2xfs
Modify Date: 2025-08-27 20:22:54
9Kab6U2xfs structure
|
Common Name | 9Kab6U2xfs | ||
|---|---|---|---|---|
| CAS Number | 76066-10-9 | Molecular Weight | 313.3 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C15H11N3O3S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 9Kab6U2xfs |
|---|
| Molecular Formula | C15H11N3O3S |
|---|---|
| Molecular Weight | 313.3 |
| InChIKey | NZQNEVJEQUMQJB-UHFFFAOYSA-N |
| SMILES | CN1c2c(n3ccccc3nc2=O)-c2ccccc2S1(=O)=O |
|
Name: Antiinflammatory activity of compound expressed as percentage inhibition of carrageen...
Source: ChEMBL
Target: Rattus norvegicus
External Id: CHEMBL878317
|
|
Name: Antiinflammatory activity of compound expressed as percentage inhibition of carrageen...
Source: ChEMBL
Target: Rattus norvegicus
External Id: CHEMBL787516
|
Total 2, Current Page 1 of 1
1