1-Acetyl-1,2-dihydro-3H-indol-3-one 3-oxime
Modify Date: 2026-09-20 14:20:40
1-Acetyl-1,2-dihydro-3H-indol-3-one 3-oxime structure
|
Common Name | 1-Acetyl-1,2-dihydro-3H-indol-3-one 3-oxime | ||
|---|---|---|---|---|
| CAS Number | 76088-17-0 | Molecular Weight | 190.20 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C10H10N2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 1-Acetyl-1,2-dihydro-3H-indol-3-one 3-oxime |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C10H10N2O2 |
|---|---|
| Molecular Weight | 190.20 |
| InChIKey | YRIHLUFLWVWVSO-UHFFFAOYSA-N |
| SMILES | CC(=O)N1CC(=NO)c2ccccc21 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the CAS number of 1-Acetyl-1,2-dihydro-3H-indol-3-one 3-oxime? |
| A: CAS number of 1-Acetyl-1,2-dihydro-3H-indol-3-one 3-oxime is 76088-17-0. |
| Q: What is the molecular weight of 1-Acetyl-1,2-dihydro-3H-indol-3-one 3-oxime? |
| A: Molecular weight of 1-Acetyl-1,2-dihydro-3H-indol-3-one 3-oxime is 190.20. |
| Q: What is the InChIKey of 1-Acetyl-1,2-dihydro-3H-indol-3-one 3-oxime? |
| A: InChIKey of 1-Acetyl-1,2-dihydro-3H-indol-3-one 3-oxime is YRIHLUFLWVWVSO-UHFFFAOYSA-N. |
| Q: What is the molecular formula of 1-Acetyl-1,2-dihydro-3H-indol-3-one 3-oxime? |
| A: Molecular formula of 1-Acetyl-1,2-dihydro-3H-indol-3-one 3-oxime is C10H10N2O2. |
| Q: What is the SMILES notation of 1-Acetyl-1,2-dihydro-3H-indol-3-one 3-oxime? |
| A: SMILES notation of 1-Acetyl-1,2-dihydro-3H-indol-3-one 3-oxime is CC(=O)N1CC(=NO)c2ccccc21. |
| Q: What is the English name of 1-Acetyl-1,2-dihydro-3H-indol-3-one 3-oxime? |
| A: The English name of 1-Acetyl-1,2-dihydro-3H-indol-3-one 3-oxime is 1-Acetyl-1,2-dihydro-3H-indol-3-one 3-oxime. |
| Q: What is the Chinese name of 76088-17-0? |
| A: Chinese name of 76088-17-0 is 76088-17-0. |