ethyl 9-oxofluorene-1-carboxylate structure
|
Common Name | ethyl 9-oxofluorene-1-carboxylate | ||
|---|---|---|---|---|
| CAS Number | 76118-81-5 | Molecular Weight | 252.26500 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C16H12O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | ethyl 9-oxofluorene-1-carboxylate |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C16H12O3 |
|---|---|
| Molecular Weight | 252.26500 |
| Exact Mass | 252.07900 |
| PSA | 43.37000 |
| LogP | 3.07470 |
| InChIKey | OWPFIGJSLUEKJW-UHFFFAOYSA-N |
| SMILES | CCOC(=O)c1cccc2c1C(=O)c1ccccc1-2 |
|
~%
ethyl 9-oxofluo... CAS#:76118-81-5 |
| Literature: Goldschmiedt; Lipschitz Monatshefte fuer Chemie, 1904 , vol. 25, p. 1174 |
|
~%
ethyl 9-oxofluo... CAS#:76118-81-5 |
| Literature: Bergmann; Orchin Journal of the American Chemical Society, 1949 , vol. 71, p. 1111 |
|
~%
ethyl 9-oxofluo... CAS#:76118-81-5 |
| Literature: Goldschmiedt; Lipschitz Monatshefte fuer Chemie, 1904 , vol. 25, p. 1174 |
|
~%
ethyl 9-oxofluo... CAS#:76118-81-5 |
| Literature: Goldschmiedt; Lipschitz Monatshefte fuer Chemie, 1904 , vol. 25, p. 1174 |
| Precursor 4 | |
|---|---|
| DownStream 0 | |
| 1-ethoxycarbonylfluorenone |
| 9-oxo-fluorene-1-carboxylic acid ethyl ester |
| 9H-Fluorene-1-carboxylic acid,9-oxo-,ethyl ester |
| 9-oxo-9H-fluorene-1-carboxylic acid,ethyl ester |
| 9-Oxo-fluoren-1-carbonsaeure-aethylester |