{2-Amino-4-(m-tolylaminomethyl)phenyl}carbamic acid ethyl ester
Modify Date: 2026-08-03 11:47:51
{2-Amino-4-(m-tolylaminomethyl)phenyl}carbamic acid ethyl ester structure
|
Common Name | {2-Amino-4-(m-tolylaminomethyl)phenyl}carbamic acid ethyl ester | ||
|---|---|---|---|---|
| CAS Number | 761413-52-9 | Molecular Weight | 299.37 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C17H21N3O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | {2-Amino-4-(m-tolylaminomethyl)phenyl}carbamic acid ethyl ester |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C17H21N3O2 |
|---|---|
| Molecular Weight | 299.37 |
| InChIKey | RNFBDOBYXLGUBY-UHFFFAOYSA-N |
| SMILES | CCOC(=O)Nc1ccc(CNc2cccc(C)c2)cc1N |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the CAS number of {2-Amino-4-(m-tolylaminomethyl)phenyl}carbamic acid ethyl ester? |
| A: CAS number of {2-Amino-4-(m-tolylaminomethyl)phenyl}carbamic acid ethyl ester is 761413-52-9. |
| Q: What is the English name of {2-Amino-4-(m-tolylaminomethyl)phenyl}carbamic acid ethyl ester? |
| A: The English name of {2-Amino-4-(m-tolylaminomethyl)phenyl}carbamic acid ethyl ester is {2-Amino-4-(m-tolylaminomethyl)phenyl}carbamic acid ethyl ester. |
| Q: What is the molecular formula of {2-Amino-4-(m-tolylaminomethyl)phenyl}carbamic acid ethyl ester? |
| A: Molecular formula of {2-Amino-4-(m-tolylaminomethyl)phenyl}carbamic acid ethyl ester is C17H21N3O2. |
| Q: What is the SMILES notation of {2-Amino-4-(m-tolylaminomethyl)phenyl}carbamic acid ethyl ester? |
| A: SMILES notation of {2-Amino-4-(m-tolylaminomethyl)phenyl}carbamic acid ethyl ester is CCOC(=O)Nc1ccc(CNc2cccc(C)c2)cc1N. |
| Q: What is the InChIKey of {2-Amino-4-(m-tolylaminomethyl)phenyl}carbamic acid ethyl ester? |
| A: InChIKey of {2-Amino-4-(m-tolylaminomethyl)phenyl}carbamic acid ethyl ester is RNFBDOBYXLGUBY-UHFFFAOYSA-N. |
| Q: What is the Chinese name of 761413-52-9? |
| A: Chinese name of 761413-52-9 is 761413-52-9. |
| Q: What is the molecular weight of {2-Amino-4-(m-tolylaminomethyl)phenyl}carbamic acid ethyl ester? |
| A: Molecular weight of {2-Amino-4-(m-tolylaminomethyl)phenyl}carbamic acid ethyl ester is 299.37. |