(4-methoxyphenyl)-(4-methyl-3-phenyl-1,4-benzothiazin-2-yl)diazene structure
|
Common Name | (4-methoxyphenyl)-(4-methyl-3-phenyl-1,4-benzothiazin-2-yl)diazene | ||
|---|---|---|---|---|
| CAS Number | 76148-77-1 | Molecular Weight | 373.47100 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C22H19N3OS | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | (4-methoxyphenyl)-(4-methyl-3-phenyl-1,4-benzothiazin-2-yl)diazene |
|---|
| Molecular Formula | C22H19N3OS |
|---|---|
| Molecular Weight | 373.47100 |
| Exact Mass | 373.12500 |
| PSA | 62.49000 |
| LogP | 6.41230 |
| InChIKey | ZLEFEPWGUOJGDS-UHFFFAOYSA-N |
| SMILES | COc1ccc(N=NC2=C(c3ccccc3)N(C)c3ccccc3S2)cc1 |
|
~%
(4-methoxypheny... CAS#:76148-77-1 |
| Literature: MacKenzie, Neil E.; Thomson, Ronald H.; Greenhalgh, Colin W. Journal of the Chemical Society, Perkin Transactions 1: Organic and Bio-Organic Chemistry (1972-1999), 1980 , p. 2923 - 2932 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |