2-propan-2-ylsulfonyl-1,3-benzothiazole
2-propan-2-ylsulfonyl-1,3-benzothiazole structure
|
Common Name | 2-propan-2-ylsulfonyl-1,3-benzothiazole | ||
|---|---|---|---|---|
| CAS Number | 76151-59-2 | Molecular Weight | 241.33000 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C10H11NO2S2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 2-propan-2-ylsulfonyl-1,3-benzothiazole |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C10H11NO2S2 |
|---|---|
| Molecular Weight | 241.33000 |
| Exact Mass | 241.02300 |
| PSA | 83.65000 |
| LogP | 3.55920 |
| InChIKey | BXSCRVCKPNPTDY-UHFFFAOYSA-N |
| SMILES | CC(C)S(=O)(=O)c1nc2ccccc2s1 |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~%
2-propan-2-ylsu... CAS#:76151-59-2 |
| Literature: Bourdon, Benjamin; Corbet, Matthieu; Fontaine, Patrice; Goekjian, Peter G.; Gueyrard, David Tetrahedron Letters, 2008 , vol. 49, # 5 p. 747 - 749 |
![Benzothiazole, 2-[(1-methylethyl)thio]- (9CI) structure](https://image.chemsrc.com/caspic/040/27410-44-2.png)
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 1 | |
|---|---|
| DownStream 0 | |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What are the upstream materials of 2-propan-2-ylsulfonyl-1,3-benzothiazole? |
| A: Related upstream materials(CAS) of 2-propan-2-ylsulfonyl-1,3-benzothiazole: 27410-44-2. |
| Q: What is the CAS number of 2-propan-2-ylsulfonyl-1,3-benzothiazole? |
| A: CAS number of 2-propan-2-ylsulfonyl-1,3-benzothiazole is 76151-59-2. |
| Q: What is the English name of 2-propan-2-ylsulfonyl-1,3-benzothiazole? |
| A: The English name of 2-propan-2-ylsulfonyl-1,3-benzothiazole is 2-propan-2-ylsulfonyl-1,3-benzothiazole. |
| Q: What is the SMILES notation of 2-propan-2-ylsulfonyl-1,3-benzothiazole? |
| A: SMILES notation of 2-propan-2-ylsulfonyl-1,3-benzothiazole is CC(C)S(=O)(=O)c1nc2ccccc2s1. |
| Q: What is the molecular weight of 2-propan-2-ylsulfonyl-1,3-benzothiazole? |
| A: Molecular weight of 2-propan-2-ylsulfonyl-1,3-benzothiazole is 241.33000. |
| Q: What is the LogP of 2-propan-2-ylsulfonyl-1,3-benzothiazole? |
| A: LogP of 2-propan-2-ylsulfonyl-1,3-benzothiazole is 3.55920. |
| Q: What is the InChIKey of 2-propan-2-ylsulfonyl-1,3-benzothiazole? |
| A: InChIKey of 2-propan-2-ylsulfonyl-1,3-benzothiazole is BXSCRVCKPNPTDY-UHFFFAOYSA-N. |
| Q: What is the molecular formula of 2-propan-2-ylsulfonyl-1,3-benzothiazole? |
| A: Molecular formula of 2-propan-2-ylsulfonyl-1,3-benzothiazole is C10H11NO2S2. |
| Q: What is the polar surface area (PSA) of 2-propan-2-ylsulfonyl-1,3-benzothiazole? |
| A: Polar surface area (PSA) of 2-propan-2-ylsulfonyl-1,3-benzothiazole is 83.65000. |
| Q: What is the Chinese name of 76151-59-2? |
| A: Chinese name of 76151-59-2 is 76151-59-2. |