ethyl 2-[(6-nitro-1,3-benzothiazol-2-yl)sulfonyl]acetate
![ethyl 2-[(6-nitro-1,3-benzothiazol-2-yl)sulfonyl]acetate Structure](https://image.chemsrc.com/caspic/382/76151-70-7.png)
ethyl 2-[(6-nitro-1,3-benzothiazol-2-yl)sulfonyl]acetate structure
|
Common Name | ethyl 2-[(6-nitro-1,3-benzothiazol-2-yl)sulfonyl]acetate | ||
|---|---|---|---|---|
| CAS Number | 76151-70-7 | Molecular Weight | 330.33700 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C11H10N2O6S2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Summary: Ethyl 2-[(6-nitro-1,3-benzothiazol-2-yl)sulfonyl]acetate, Chinese name: 乙基(6-硝基-1,3-苯并噻唑-2-基)磺酰基丙酸酯, CAS number: 76151-70-7, molecular formula: C11H10N2O6S2, molecular weight: 330.34. For research-use only, not for medical or clinical usage.
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | ethyl 2-[(6-nitro-1,3-benzothiazol-2-yl)sulfonyl]acetate |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C11H10N2O6S2 |
|---|---|
| Molecular Weight | 330.33700 |
| Exact Mass | 329.99800 |
| PSA | 155.77000 |
| LogP | 3.14530 |
| InChIKey | FZUMOVRHXHXNAS-UHFFFAOYSA-N |
| SMILES | CCOC(=O)CS(=O)(=O)c1nc2ccc([N+](=O)[O-])cc2s1 |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~%
ethyl 2-[(6-nit... CAS#:76151-70-7 |
| Literature: Alekseewa; Postowskii Zhurnal Obshchei Khimii, 1954 , vol. 24, p. 1814,1817; engl. Ausg. S. 1781, 1783 |
|
~%
ethyl 2-[(6-nit... CAS#:76151-70-7 |
| Literature: Alekseewa; Postowskii Zhurnal Obshchei Khimii, 1954 , vol. 24, p. 1814,1817; engl. Ausg. S. 1781, 1783 |
![ethyl 2-[(6-nitro-1,3-benzothiazol-2-yl)sulfanyl]acetate structure](https://image.chemsrc.com/caspic/085/51618-32-7.png)
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 2 | |
|---|---|
| DownStream 0 | |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular weight of ethyl 2-[(6-nitro-1,3-benzothiazol-2-yl)sulfonyl]acetate? |
| A: Molecular weight of ethyl 2-[(6-nitro-1,3-benzothiazol-2-yl)sulfonyl]acetate is 330.33700. |
| Q: What is the SMILES notation of ethyl 2-[(6-nitro-1,3-benzothiazol-2-yl)sulfonyl]acetate? |
| A: SMILES notation of ethyl 2-[(6-nitro-1,3-benzothiazol-2-yl)sulfonyl]acetate is CCOC(=O)CS(=O)(=O)c1nc2ccc([N+](=O)[O-])cc2s1. |
| Q: What is the LogP of ethyl 2-[(6-nitro-1,3-benzothiazol-2-yl)sulfonyl]acetate? |
| A: LogP of ethyl 2-[(6-nitro-1,3-benzothiazol-2-yl)sulfonyl]acetate is 3.14530. |
| Q: What is the English name of ethyl 2-[(6-nitro-1,3-benzothiazol-2-yl)sulfonyl]acetate? |
| A: The English name of ethyl 2-[(6-nitro-1,3-benzothiazol-2-yl)sulfonyl]acetate is ethyl 2-[(6-nitro-1,3-benzothiazol-2-yl)sulfonyl]acetate. |
| Q: What is the Chinese name of 76151-70-7? |
| A: Chinese name of 76151-70-7 is 76151-70-7. |
| Q: What is the molecular formula of ethyl 2-[(6-nitro-1,3-benzothiazol-2-yl)sulfonyl]acetate? |
| A: Molecular formula of ethyl 2-[(6-nitro-1,3-benzothiazol-2-yl)sulfonyl]acetate is C11H10N2O6S2. |
| Q: What are the upstream materials of ethyl 2-[(6-nitro-1,3-benzothiazol-2-yl)sulfonyl]acetate? |
| A: Related upstream materials(CAS) of ethyl 2-[(6-nitro-1,3-benzothiazol-2-yl)sulfonyl]acetate: 51618-32-7;4845-58-3. |
| Q: What is the CAS number of ethyl 2-[(6-nitro-1,3-benzothiazol-2-yl)sulfonyl]acetate? |
| A: CAS number of ethyl 2-[(6-nitro-1,3-benzothiazol-2-yl)sulfonyl]acetate is 76151-70-7. |
| Q: What is the InChIKey of ethyl 2-[(6-nitro-1,3-benzothiazol-2-yl)sulfonyl]acetate? |
| A: InChIKey of ethyl 2-[(6-nitro-1,3-benzothiazol-2-yl)sulfonyl]acetate is FZUMOVRHXHXNAS-UHFFFAOYSA-N. |
| Q: What is the polar surface area (PSA) of ethyl 2-[(6-nitro-1,3-benzothiazol-2-yl)sulfonyl]acetate? |
| A: Polar surface area (PSA) of ethyl 2-[(6-nitro-1,3-benzothiazol-2-yl)sulfonyl]acetate is 155.77000. |