4,5-Dimethoxyindoline-2,3-dione
Modify Date: 2026-08-04 10:13:36
4,5-Dimethoxyindoline-2,3-dione structure
|
Common Name | 4,5-Dimethoxyindoline-2,3-dione | ||
|---|---|---|---|---|
| CAS Number | 76159-83-6 | Molecular Weight | 207.18 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C10H9NO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 4,5-Dimethoxyindoline-2,3-dione |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C10H9NO4 |
|---|---|
| Molecular Weight | 207.18 |
| InChIKey | GDILOIAVCVRXFN-UHFFFAOYSA-N |
| SMILES | COc1ccc2c(c1OC)C(=O)C(=O)N2 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the CAS number of 4,5-Dimethoxyindoline-2,3-dione? |
| A: CAS number of 4,5-Dimethoxyindoline-2,3-dione is 76159-83-6. |
| Q: What is the SMILES notation of 4,5-Dimethoxyindoline-2,3-dione? |
| A: SMILES notation of 4,5-Dimethoxyindoline-2,3-dione is COc1ccc2c(c1OC)C(=O)C(=O)N2. |
| Q: What is the Chinese name of 76159-83-6? |
| A: Chinese name of 76159-83-6 is 76159-83-6. |
| Q: What is the InChIKey of 4,5-Dimethoxyindoline-2,3-dione? |
| A: InChIKey of 4,5-Dimethoxyindoline-2,3-dione is GDILOIAVCVRXFN-UHFFFAOYSA-N. |
| Q: What is the molecular weight of 4,5-Dimethoxyindoline-2,3-dione? |
| A: Molecular weight of 4,5-Dimethoxyindoline-2,3-dione is 207.18. |
| Q: What is the molecular formula of 4,5-Dimethoxyindoline-2,3-dione? |
| A: Molecular formula of 4,5-Dimethoxyindoline-2,3-dione is C10H9NO4. |
| Q: What is the English name of 4,5-Dimethoxyindoline-2,3-dione? |
| A: The English name of 4,5-Dimethoxyindoline-2,3-dione is 4,5-Dimethoxyindoline-2,3-dione. |