2-(9,10-DIOXO-9,10-DIHYDRO-2-ANTHRACENYL)ACETIC ACID structure
|
Common Name | 2-(9,10-DIOXO-9,10-DIHYDRO-2-ANTHRACENYL)ACETIC ACID | ||
|---|---|---|---|---|
| CAS Number | 76161-80-3 | Molecular Weight | 266.24800 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C16H10O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2-(9,10-dioxoanthracen-2-yl)acetic acid |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C16H10O4 |
|---|---|
| Molecular Weight | 266.24800 |
| Exact Mass | 266.05800 |
| PSA | 71.44000 |
| LogP | 2.08910 |
| InChIKey | NRIDTWIMIZBRGT-UHFFFAOYSA-N |
| SMILES | O=C(O)Cc1ccc2c(c1)C(=O)c1ccccc1C2=O |
| HS Code | 2918300090 |
|---|
|
~%
2-(9,10-DIOXO-9... CAS#:76161-80-3 |
| Literature: Xu; Wan Chemical Communications, 2000 , # 21 p. 2147 - 2148 |
|
~%
2-(9,10-DIOXO-9... CAS#:76161-80-3 |
| Literature: Xu; Wan Chemical Communications, 2000 , # 21 p. 2147 - 2148 |
| Precursor 2 | |
|---|---|
| DownStream 1 | |
| HS Code | 2918300090 |
|---|---|
| Summary | 2918300090 other carboxylic acids with aldehyde or ketone function but without other oxygen function, their anhydrides, halides, peroxides, peroxyacids and their derivatives。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
| 2-(9,10-dioxo-2-anthryl)acetic acid |
| dioxodihydroanthracenylaceticacid |