Propanoic acid, 2-hydroxy-, compd. with 1,5-dimethyl-6H-pyrido(4,3-b)c arbazole (1:1) structure
|
Common Name | Propanoic acid, 2-hydroxy-, compd. with 1,5-dimethyl-6H-pyrido(4,3-b)c arbazole (1:1) | ||
|---|---|---|---|---|
| CAS Number | 76201-88-2 | Molecular Weight | 336.38400 | |
| Density | N/A | Boiling Point | 493.9ºC at 760 mmHg | |
| Molecular Formula | C20H20N2O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 226.3ºC | |
| Name | 1,5-dimethyl-6H-pyrido[4,3-b]carbazole,2-hydroxypropanoic acid |
|---|---|
| Synonym | More Synonyms |
| Boiling Point | 493.9ºC at 760 mmHg |
|---|---|
| Molecular Formula | C20H20N2O3 |
| Molecular Weight | 336.38400 |
| Flash Point | 226.3ºC |
| Exact Mass | 336.14700 |
| PSA | 86.21000 |
| LogP | 3.93790 |
| InChIKey | WEJNKWVUDZYMOT-UHFFFAOYSA-N |
| SMILES | CC(O)C(=O)O.Cc1[nH]ccc2c(C)c3nc4ccccc4c3cc12 |
| Olivacine lactate |