methyl 3-(2-chlorophenyl)-2-isocyanoprop-2-enoate
methyl 3-(2-chlorophenyl)-2-isocyanoprop-2-enoate structure
|
Common Name | methyl 3-(2-chlorophenyl)-2-isocyanoprop-2-enoate | ||
|---|---|---|---|---|
| CAS Number | 76202-92-1 | Molecular Weight | 221.64000 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C11H8ClNO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | methyl 3-(2-chlorophenyl)-2-isocyanoprop-2-enoate |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C11H8ClNO2 |
|---|---|
| Molecular Weight | 221.64000 |
| Exact Mass | 221.02400 |
| PSA | 26.30000 |
| LogP | 2.00390 |
| InChIKey | UHHYUGWASHABEX-UHFFFAOYSA-N |
| SMILES | [C-]#[N+]C(=Cc1ccccc1Cl)C(=O)OC |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~89%
methyl 3-(2-chl... CAS#:76202-92-1 |
| Literature: Suzuki; Nunami; Matsumoto; et al. Chemical and Pharmaceutical Bulletin, 1980 , vol. 28, # 8 p. 2374 - 2383 |
|
~%
methyl 3-(2-chl... CAS#:76202-92-1 |
| Literature: Suzuki; Nunami; Matsumoto; et al. Chemical and Pharmaceutical Bulletin, 1980 , vol. 28, # 8 p. 2374 - 2383 |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 2 | |
|---|---|
| DownStream 1 | |
CAS#:71845-14-2This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the CAS number of methyl 3-(2-chlorophenyl)-2-isocyanoprop-2-enoate? |
| A: CAS number of methyl 3-(2-chlorophenyl)-2-isocyanoprop-2-enoate is 76202-92-1. |
| Q: What is the English name of methyl 3-(2-chlorophenyl)-2-isocyanoprop-2-enoate? |
| A: The English name of methyl 3-(2-chlorophenyl)-2-isocyanoprop-2-enoate is methyl 3-(2-chlorophenyl)-2-isocyanoprop-2-enoate. |
| Q: What are the downstream products of methyl 3-(2-chlorophenyl)-2-isocyanoprop-2-enoate? |
| A: Related downstream products(CAS) of methyl 3-(2-chlorophenyl)-2-isocyanoprop-2-enoate: 71845-14-2. |
| Q: What is the SMILES notation of methyl 3-(2-chlorophenyl)-2-isocyanoprop-2-enoate? |
| A: SMILES notation of methyl 3-(2-chlorophenyl)-2-isocyanoprop-2-enoate is [C-]#[N+]C(=Cc1ccccc1Cl)C(=O)OC. |
| Q: What is the molecular weight of methyl 3-(2-chlorophenyl)-2-isocyanoprop-2-enoate? |
| A: Molecular weight of methyl 3-(2-chlorophenyl)-2-isocyanoprop-2-enoate is 221.64000. |
| Q: What are the upstream materials of methyl 3-(2-chlorophenyl)-2-isocyanoprop-2-enoate? |
| A: Related upstream materials(CAS) of methyl 3-(2-chlorophenyl)-2-isocyanoprop-2-enoate: 76203-26-4;89-98-5. |
| Q: What is the LogP of methyl 3-(2-chlorophenyl)-2-isocyanoprop-2-enoate? |
| A: LogP of methyl 3-(2-chlorophenyl)-2-isocyanoprop-2-enoate is 2.00390. |
| Q: What is the polar surface area (PSA) of methyl 3-(2-chlorophenyl)-2-isocyanoprop-2-enoate? |
| A: Polar surface area (PSA) of methyl 3-(2-chlorophenyl)-2-isocyanoprop-2-enoate is 26.30000. |
| Q: What is the Chinese name of 76202-92-1? |
| A: Chinese name of 76202-92-1 is 76202-92-1. |
| Q: What is the InChIKey of methyl 3-(2-chlorophenyl)-2-isocyanoprop-2-enoate? |
| A: InChIKey of methyl 3-(2-chlorophenyl)-2-isocyanoprop-2-enoate is UHHYUGWASHABEX-UHFFFAOYSA-N. |