methyl 2-isocyano-3,3-diphenylprop-2-enoate structure
|
Common Name | methyl 2-isocyano-3,3-diphenylprop-2-enoate | ||
|---|---|---|---|---|
| CAS Number | 76203-05-9 | Molecular Weight | 263.29100 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C17H13NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | methyl 2-isocyano-3,3-diphenylprop-2-enoate |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C17H13NO2 |
|---|---|
| Molecular Weight | 263.29100 |
| Exact Mass | 263.09500 |
| PSA | 26.30000 |
| LogP | 2.76900 |
| InChIKey | LKJUNCVTZZCJHV-UHFFFAOYSA-N |
| SMILES | [C-]#[N+]C(C(=O)OC)=C(c1ccccc1)c1ccccc1 |
|
~90%
methyl 2-isocya... CAS#:76203-05-9 |
| Literature: Suzuki; Nunami; Matsumoto; et al. Chemical and Pharmaceutical Bulletin, 1980 , vol. 28, # 8 p. 2374 - 2383 |
|
~%
methyl 2-isocya... CAS#:76203-05-9 |
| Literature: Suzuki; Nunami; Matsumoto; et al. Chemical and Pharmaceutical Bulletin, 1980 , vol. 28, # 8 p. 2374 - 2383 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| 2-Propenoic acid,2-isocyano-3,3-diphenyl-,methyl ester |
| methyl 2-isocyano-3,3-diphenylacrylate |