[tert-butyl-(4-methylbenzoyl)amino] 4-methylbenzoate structure
|
Common Name | [tert-butyl-(4-methylbenzoyl)amino] 4-methylbenzoate | ||
|---|---|---|---|---|
| CAS Number | 76204-05-2 | Molecular Weight | 325.40200 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C20H23NO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | [tert-butyl-(4-methylbenzoyl)amino] 4-methylbenzoate |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C20H23NO3 |
|---|---|
| Molecular Weight | 325.40200 |
| Exact Mass | 325.16800 |
| PSA | 46.61000 |
| LogP | 4.31610 |
| InChIKey | VJCDSDROFFMVRS-UHFFFAOYSA-N |
| SMILES | Cc1ccc(C(=O)ON(C(=O)c2ccc(C)cc2)C(C)(C)C)cc1 |
|
~63%
[tert-butyl-(4-... CAS#:76204-05-2 |
| Literature: Uchida, Yuzuru; Hashimoto, Yukinobu; Kozuka, Seizi Bulletin of the Chemical Society of Japan, 1980 , vol. 53, # 8 p. 2309 - 2314 |
|
~%
[tert-butyl-(4-... CAS#:76204-05-2
Detail
|
| Literature: Smith, John; Tedder, John M. Journal of the Chemical Society, Perkin Transactions 2: Physical Organic Chemistry (1972-1999), 1987 , p. 895 - 896 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| N-t-butyl-N-4'-toluoyl-O-4''-toluoylhydroxylamine |