2-ACETAMIDO-2-DEOX-4-O-(ALPHA-L-FUCOPYRANOSYL)-D-GLUCOPYRANOSE
2-ACETAMIDO-2-DEOX-4-O-(ALPHA-L-FUCOPYRANOSYL)-D-GLUCOPYRANOSE structure
|
Common Name | 2-ACETAMIDO-2-DEOX-4-O-(ALPHA-L-FUCOPYRANOSYL)-D-GLUCOPYRANOSE | ||
|---|---|---|---|---|
| CAS Number | 76211-71-7 | Molecular Weight | 367.34900 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C14H25NO10 | Melting Point | 216-218ºC | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 2-acetamido-2-deoxy-4-o-(a-l-fucopyranosyl)-d-glucopyranose |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Melting Point | 216-218ºC |
|---|---|
| Molecular Formula | C14H25NO10 |
| Molecular Weight | 367.34900 |
| Exact Mass | 367.14800 |
| PSA | 178.17000 |
| Index of Refraction | 1.601 |
| InChIKey | YSVYPLBRZMVZJE-ZLWCJOGGSA-N |
| SMILES | CC(=O)NC1C(O)OC(CO)C(OC2OC(C)C(O)C(O)C2O)C1O |
| Storage condition | 2-8°C |
This table covers safety warnings, protective measures, incompatible substances and disposal guidelines for this compound.
| HS Code | 29400090 |
|---|
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| 2-ACETAMIDO-2-DEOXY-4-O-A-L-FUCOPYRANOSY L-D-GLUCOP |
| FUC1-A-4GLCNAC |
| 2-acetamido-2-deoxy-4-O-A-L-*fucopyranosyl-D-gluc |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the melting point of 2-acetamido-2-deoxy-4-o-(a-l-fucopyranosyl)-d-glucopyranose? |
| A: Melting point of 2-acetamido-2-deoxy-4-o-(a-l-fucopyranosyl)-d-glucopyranose is 216-218ºC. |
| Q: What English synonyms does 2-acetamido-2-deoxy-4-o-(a-l-fucopyranosyl)-d-glucopyranose have? |
| A: English synonyms of 2-acetamido-2-deoxy-4-o-(a-l-fucopyranosyl)-d-glucopyranose: 2-ACETAMIDO-2-DEOXY-4-O-A-L-FUCOPYRANOSY L-D-GLUCOP, FUC1-A-4GLCNAC, 2-acetamido-2-deoxy-4-O-A-L-*fucopyranosyl-D-gluc. |
| Q: What is the molecular formula of 2-acetamido-2-deoxy-4-o-(a-l-fucopyranosyl)-d-glucopyranose? |
| A: Molecular formula of 2-acetamido-2-deoxy-4-o-(a-l-fucopyranosyl)-d-glucopyranose is C14H25NO10. |
| Q: What is the English name of 2-acetamido-2-deoxy-4-o-(a-l-fucopyranosyl)-d-glucopyranose? |
| A: The English name of 2-acetamido-2-deoxy-4-o-(a-l-fucopyranosyl)-d-glucopyranose is 2-acetamido-2-deoxy-4-o-(a-l-fucopyranosyl)-d-glucopyranose. |
| Q: What is the molecular weight of 2-acetamido-2-deoxy-4-o-(a-l-fucopyranosyl)-d-glucopyranose? |
| A: Molecular weight of 2-acetamido-2-deoxy-4-o-(a-l-fucopyranosyl)-d-glucopyranose is 367.34900. |
| Q: What is the polar surface area (PSA) of 2-acetamido-2-deoxy-4-o-(a-l-fucopyranosyl)-d-glucopyranose? |
| A: Polar surface area (PSA) of 2-acetamido-2-deoxy-4-o-(a-l-fucopyranosyl)-d-glucopyranose is 178.17000. |
| Q: What is the InChIKey of 2-acetamido-2-deoxy-4-o-(a-l-fucopyranosyl)-d-glucopyranose? |
| A: InChIKey of 2-acetamido-2-deoxy-4-o-(a-l-fucopyranosyl)-d-glucopyranose is YSVYPLBRZMVZJE-ZLWCJOGGSA-N. |
| Q: What are the storage conditions for 2-acetamido-2-deoxy-4-o-(a-l-fucopyranosyl)-d-glucopyranose? |
| A: Storage conditions for 2-acetamido-2-deoxy-4-o-(a-l-fucopyranosyl)-d-glucopyranose: 2-8°C. |
| Q: What is the SMILES notation of 2-acetamido-2-deoxy-4-o-(a-l-fucopyranosyl)-d-glucopyranose? |
| A: SMILES notation of 2-acetamido-2-deoxy-4-o-(a-l-fucopyranosyl)-d-glucopyranose is CC(=O)NC1C(O)OC(CO)C(OC2OC(C)C(O)C(O)C2O)C1O. |
| Q: What is the CAS number of 2-acetamido-2-deoxy-4-o-(a-l-fucopyranosyl)-d-glucopyranose? |
| A: CAS number of 2-acetamido-2-deoxy-4-o-(a-l-fucopyranosyl)-d-glucopyranose is 76211-71-7. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Shanghai Nianxing Industrial Co., Ltd |
| Dayang Chem (Hangzhou) Co., Ltd. |