Pyridine,2-(3,5-dimethyl-1H-pyrazol-1-yl)-5-nitro
Pyridine,2-(3,5-dimethyl-1H-pyrazol-1-yl)-5-nitro structure
|
Common Name | Pyridine,2-(3,5-dimethyl-1H-pyrazol-1-yl)-5-nitro | ||
|---|---|---|---|---|
| CAS Number | 76211-92-2 | Molecular Weight | 218.21200 | |
| Density | 1.36g/cm3 | Boiling Point | 373ºC at 760mmHg | |
| Molecular Formula | C10H10N4O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 179.4ºC | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 2-(3,5-dimethylpyrazol-1-yl)-5-nitropyridine |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Density | 1.36g/cm3 |
|---|---|
| Boiling Point | 373ºC at 760mmHg |
| Molecular Formula | C10H10N4O2 |
| Molecular Weight | 218.21200 |
| Flash Point | 179.4ºC |
| Exact Mass | 218.08000 |
| PSA | 76.53000 |
| LogP | 2.31550 |
| Index of Refraction | 1.655 |
| InChIKey | HZNRYZPDTGPQPQ-UHFFFAOYSA-N |
| SMILES | Cc1cc(C)n(-c2ccc([N+](=O)[O-])cn2)n1 |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~62%
Pyridine,2-(3,5... CAS#:76211-92-2 |
| Literature: Khan, Misbahul A.; Pinto, Alvaro A. A. Monatshefte fuer Chemie, 1980 , vol. 111, p. 883 - 888 |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 2 | |
|---|---|
| DownStream 0 | |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| 2r-0638 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the English name of 2-(3,5-dimethylpyrazol-1-yl)-5-nitropyridine? |
| A: The English name of 2-(3,5-dimethylpyrazol-1-yl)-5-nitropyridine is 2-(3,5-dimethylpyrazol-1-yl)-5-nitropyridine. |
| Q: What is the molecular weight of 2-(3,5-dimethylpyrazol-1-yl)-5-nitropyridine? |
| A: Molecular weight of 2-(3,5-dimethylpyrazol-1-yl)-5-nitropyridine is 218.21200. |
| Q: What is the CAS number of 2-(3,5-dimethylpyrazol-1-yl)-5-nitropyridine? |
| A: CAS number of 2-(3,5-dimethylpyrazol-1-yl)-5-nitropyridine is 76211-92-2. |
| Q: What is the molecular formula of 2-(3,5-dimethylpyrazol-1-yl)-5-nitropyridine? |
| A: Molecular formula of 2-(3,5-dimethylpyrazol-1-yl)-5-nitropyridine is C10H10N4O2. |
| Q: What is the boiling point of 2-(3,5-dimethylpyrazol-1-yl)-5-nitropyridine? |
| A: Boiling point of 2-(3,5-dimethylpyrazol-1-yl)-5-nitropyridine is 373ºC at 760mmHg. |
| Q: What is the SMILES notation of 2-(3,5-dimethylpyrazol-1-yl)-5-nitropyridine? |
| A: SMILES notation of 2-(3,5-dimethylpyrazol-1-yl)-5-nitropyridine is Cc1cc(C)n(-c2ccc([N+](=O)[O-])cn2)n1. |
| Q: What are the upstream materials of 2-(3,5-dimethylpyrazol-1-yl)-5-nitropyridine? |
| A: Related upstream materials(CAS) of 2-(3,5-dimethylpyrazol-1-yl)-5-nitropyridine: 6343-98-2;123-54-6. |
| Q: What is the LogP of 2-(3,5-dimethylpyrazol-1-yl)-5-nitropyridine? |
| A: LogP of 2-(3,5-dimethylpyrazol-1-yl)-5-nitropyridine is 2.31550. |
| Q: What is the Chinese name of 76211-92-2? |
| A: Chinese name of 76211-92-2 is 76211-92-2. |
| Q: What is the InChIKey of 2-(3,5-dimethylpyrazol-1-yl)-5-nitropyridine? |
| A: InChIKey of 2-(3,5-dimethylpyrazol-1-yl)-5-nitropyridine is HZNRYZPDTGPQPQ-UHFFFAOYSA-N. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Dayang Chem (Hangzhou) Co., Ltd. |