1-[2-[(2-acetylphenyl)disulfanyl]phenyl]ethanone structure
|
Common Name | 1-[2-[(2-acetylphenyl)disulfanyl]phenyl]ethanone | ||
|---|---|---|---|---|
| CAS Number | 76256-33-2 | Molecular Weight | 302.41100 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C16H14O2S2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 1-[2-[(2-acetylphenyl)disulfanyl]phenyl]ethanone |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C16H14O2S2 |
|---|---|
| Molecular Weight | 302.41100 |
| Exact Mass | 302.04400 |
| PSA | 84.74000 |
| LogP | 4.89120 |
| InChIKey | DWYLEEOHUAYTPN-UHFFFAOYSA-N |
| SMILES | CC(=O)c1ccccc1SSc1ccccc1C(C)=O |
|
~%
1-[2-[(2-acetyl... CAS#:76256-33-2 |
| Literature: Nakazumi,H.; Kitao,T. Bulletin of the Chemical Society of Japan, 1977 , vol. 50, p. 939 - 944 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| Disulfid aus 2-Mercapto-acetophenon |