3-[4-(trifluoromethyl)phenoxy]azetidine structure
|
Common Name | 3-[4-(trifluoromethyl)phenoxy]azetidine | ||
|---|---|---|---|---|
| CAS Number | 76263-21-3 | Molecular Weight | 217.18800 | |
| Density | 1.277g/cm3 | Boiling Point | 257.3ºC at 760 mmHg | |
| Molecular Formula | C10H10F3NO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 3-[4-(trifluoromethyl)phenoxy]azetidine |
|---|
| Density | 1.277g/cm3 |
|---|---|
| Boiling Point | 257.3ºC at 760 mmHg |
| Molecular Formula | C10H10F3NO |
| Molecular Weight | 217.18800 |
| Exact Mass | 217.07100 |
| PSA | 21.26000 |
| LogP | 2.38480 |
| Index of Refraction | 1.481 |
| InChIKey | RKANEZKQFZAZHZ-UHFFFAOYSA-N |
| SMILES | FC(F)(F)c1ccc(OC2CNC2)cc1 |
| HS Code | 2933990090 |
|---|
|
~80%
3-[4-(trifluoro... CAS#:76263-21-3 |
| Literature: Pfizer Inc. Patent: US2010/190771 A1, 2010 ; Location in patent: Page/Page column 28 ; |
|
~%
3-[4-(trifluoro... CAS#:76263-21-3 |
| Literature: WO2012/76063 A1, ; Page/Page column 60 ; WO 2012/076063 A1 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |