acetic acid,3-bromo-2-methyl-6-methylideneoct-7-en-2-ol
acetic acid,3-bromo-2-methyl-6-methylideneoct-7-en-2-ol structure
|
Common Name | acetic acid,3-bromo-2-methyl-6-methylideneoct-7-en-2-ol | ||
|---|---|---|---|---|
| CAS Number | 76280-57-4 | Molecular Weight | 293.19700 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C12H21BrO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | acetic acid,3-bromo-2-methyl-6-methylideneoct-7-en-2-ol |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C12H21BrO3 |
|---|---|
| Molecular Weight | 293.19700 |
| Exact Mass | 292.06700 |
| PSA | 57.53000 |
| LogP | 3.13410 |
| InChIKey | ZGOPOZXHZASGGB-UHFFFAOYSA-N |
| SMILES | C=CC(=C)CCC(Br)C(C)(C)O.CC(=O)O |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~39%
acetic acid,3-b... CAS#:76280-57-4 |
| Literature: Schulze, Klaus; Haufe, Guenter; Koehler, Guenther Zeitschrift fuer Chemie (Stuttgart, Germany), 1980 , vol. 20, # 8 p. 293 - 294 |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 2 | |
|---|---|
| DownStream 1 | |
CAS#:1118-39-4This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| 7-Octen-2-ol,3-bromo-2-methyl-6-methylene-,acetate |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular formula of acetic acid,3-bromo-2-methyl-6-methylideneoct-7-en-2-ol? |
| A: Molecular formula of acetic acid,3-bromo-2-methyl-6-methylideneoct-7-en-2-ol is C12H21BrO3. |
| Q: What is the polar surface area (PSA) of acetic acid,3-bromo-2-methyl-6-methylideneoct-7-en-2-ol? |
| A: Polar surface area (PSA) of acetic acid,3-bromo-2-methyl-6-methylideneoct-7-en-2-ol is 57.53000. |
| Q: What are the downstream products of acetic acid,3-bromo-2-methyl-6-methylideneoct-7-en-2-ol? |
| A: Related downstream products(CAS) of acetic acid,3-bromo-2-methyl-6-methylideneoct-7-en-2-ol: 1118-39-4. |
| Q: What is the LogP of acetic acid,3-bromo-2-methyl-6-methylideneoct-7-en-2-ol? |
| A: LogP of acetic acid,3-bromo-2-methyl-6-methylideneoct-7-en-2-ol is 3.13410. |
| Q: What are the upstream materials of acetic acid,3-bromo-2-methyl-6-methylideneoct-7-en-2-ol? |
| A: Related upstream materials(CAS) of acetic acid,3-bromo-2-methyl-6-methylideneoct-7-en-2-ol: 123-35-3;64-19-7. |
| Q: What is the English name of acetic acid,3-bromo-2-methyl-6-methylideneoct-7-en-2-ol? |
| A: The English name of acetic acid,3-bromo-2-methyl-6-methylideneoct-7-en-2-ol is acetic acid,3-bromo-2-methyl-6-methylideneoct-7-en-2-ol. |
| Q: What is the CAS number of acetic acid,3-bromo-2-methyl-6-methylideneoct-7-en-2-ol? |
| A: CAS number of acetic acid,3-bromo-2-methyl-6-methylideneoct-7-en-2-ol is 76280-57-4. |
| Q: What is the molecular weight of acetic acid,3-bromo-2-methyl-6-methylideneoct-7-en-2-ol? |
| A: Molecular weight of acetic acid,3-bromo-2-methyl-6-methylideneoct-7-en-2-ol is 293.19700. |
| Q: What is the SMILES notation of acetic acid,3-bromo-2-methyl-6-methylideneoct-7-en-2-ol? |
| A: SMILES notation of acetic acid,3-bromo-2-methyl-6-methylideneoct-7-en-2-ol is C=CC(=C)CCC(Br)C(C)(C)O.CC(=O)O. |
| Q: What is the InChIKey of acetic acid,3-bromo-2-methyl-6-methylideneoct-7-en-2-ol? |
| A: InChIKey of acetic acid,3-bromo-2-methyl-6-methylideneoct-7-en-2-ol is ZGOPOZXHZASGGB-UHFFFAOYSA-N. |