5-thiophen-2-yl-3,4-dihydro-2H-1,6-benzothiazocine
Modify Date: 2026-07-03 08:07:22
5-thiophen-2-yl-3,4-dihydro-2H-1,6-benzothiazocine structure
|
Common Name | 5-thiophen-2-yl-3,4-dihydro-2H-1,6-benzothiazocine | ||
|---|---|---|---|---|
| CAS Number | 76293-59-9 | Molecular Weight | 259.39000 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C14H13NS2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 5-thiophen-2-yl-3,4-dihydro-2H-1,6-benzothiazocine |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C14H13NS2 |
|---|---|
| Molecular Weight | 259.39000 |
| Exact Mass | 259.04900 |
| PSA | 65.90000 |
| LogP | 4.19040 |
| InChIKey | OBOCRWIOGCMNFF-UHFFFAOYSA-N |
| SMILES | c1csc(C2=Nc3ccccc3SCCC2)c1 |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 0 | |
|---|---|
| DownStream 3 | |
CAS#:87697-01-6
CAS#:87697-06-1
CAS#:87697-10-7This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the Chinese name of 76293-59-9? |
| A: Chinese name of 76293-59-9 is 76293-59-9. |
| Q: What is the LogP of 5-thiophen-2-yl-3,4-dihydro-2H-1,6-benzothiazocine? |
| A: LogP of 5-thiophen-2-yl-3,4-dihydro-2H-1,6-benzothiazocine is 4.19040. |
| Q: What is the molecular formula of 5-thiophen-2-yl-3,4-dihydro-2H-1,6-benzothiazocine? |
| A: Molecular formula of 5-thiophen-2-yl-3,4-dihydro-2H-1,6-benzothiazocine is C14H13NS2. |
| Q: What is the English name of 5-thiophen-2-yl-3,4-dihydro-2H-1,6-benzothiazocine? |
| A: The English name of 5-thiophen-2-yl-3,4-dihydro-2H-1,6-benzothiazocine is 5-thiophen-2-yl-3,4-dihydro-2H-1,6-benzothiazocine. |
| Q: What is the CAS number of 5-thiophen-2-yl-3,4-dihydro-2H-1,6-benzothiazocine? |
| A: CAS number of 5-thiophen-2-yl-3,4-dihydro-2H-1,6-benzothiazocine is 76293-59-9. |
| Q: What are the downstream products of 5-thiophen-2-yl-3,4-dihydro-2H-1,6-benzothiazocine? |
| A: Related downstream products(CAS) of 5-thiophen-2-yl-3,4-dihydro-2H-1,6-benzothiazocine: 87697-01-6;87697-06-1;87697-10-7. |
| Q: What is the InChIKey of 5-thiophen-2-yl-3,4-dihydro-2H-1,6-benzothiazocine? |
| A: InChIKey of 5-thiophen-2-yl-3,4-dihydro-2H-1,6-benzothiazocine is OBOCRWIOGCMNFF-UHFFFAOYSA-N. |
| Q: What is the SMILES notation of 5-thiophen-2-yl-3,4-dihydro-2H-1,6-benzothiazocine? |
| A: SMILES notation of 5-thiophen-2-yl-3,4-dihydro-2H-1,6-benzothiazocine is c1csc(C2=Nc3ccccc3SCCC2)c1. |
| Q: What is the polar surface area (PSA) of 5-thiophen-2-yl-3,4-dihydro-2H-1,6-benzothiazocine? |
| A: Polar surface area (PSA) of 5-thiophen-2-yl-3,4-dihydro-2H-1,6-benzothiazocine is 65.90000. |
| Q: What is the molecular weight of 5-thiophen-2-yl-3,4-dihydro-2H-1,6-benzothiazocine? |
| A: Molecular weight of 5-thiophen-2-yl-3,4-dihydro-2H-1,6-benzothiazocine is 259.39000. |