hex-5-enyl undec-10-enoate
hex-5-enyl undec-10-enoate structure
|
Common Name | hex-5-enyl undec-10-enoate | ||
|---|---|---|---|---|
| CAS Number | 76293-70-4 | Molecular Weight | 266.41900 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C17H30O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | hex-5-enyl undec-10-enoate |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C17H30O2 |
|---|---|
| Molecular Weight | 266.41900 |
| Exact Mass | 266.22500 |
| PSA | 26.30000 |
| LogP | 5.19270 |
| InChIKey | HJCMEKJDZVRSGY-UHFFFAOYSA-N |
| SMILES | C=CCCCCCCCCC(=O)OCCCCC=C |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~91%
hex-5-enyl unde... CAS#:76293-70-4 |
| Literature: Villemin, Didier Tetrahedron Letters, 1980 , vol. 21, p. 1715 - 1718 |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 2 | |
|---|---|
| DownStream 2 | |
CAS#:76293-72-6
CAS#:54509-73-8This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| 5-hexenyl 10-undecenoate |
| 10-Undecenoic acid,5-hexenyl ester |
| 5-hexenyl-10-undecanoate |
| 5-hexen-1-yl 10-undecenoate |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular formula of hex-5-enyl undec-10-enoate? |
| A: Molecular formula of hex-5-enyl undec-10-enoate is C17H30O2. |
| Q: What are the downstream products of hex-5-enyl undec-10-enoate? |
| A: Related downstream products(CAS) of hex-5-enyl undec-10-enoate: 76293-72-6;54509-73-8. |
| Q: What is the English name of hex-5-enyl undec-10-enoate? |
| A: The English name of hex-5-enyl undec-10-enoate is hex-5-enyl undec-10-enoate. |
| Q: What is the SMILES notation of hex-5-enyl undec-10-enoate? |
| A: SMILES notation of hex-5-enyl undec-10-enoate is C=CCCCCCCCCC(=O)OCCCCC=C. |
| Q: What is the InChIKey of hex-5-enyl undec-10-enoate? |
| A: InChIKey of hex-5-enyl undec-10-enoate is HJCMEKJDZVRSGY-UHFFFAOYSA-N. |
| Q: What is the LogP of hex-5-enyl undec-10-enoate? |
| A: LogP of hex-5-enyl undec-10-enoate is 5.19270. |
| Q: What are the upstream materials of hex-5-enyl undec-10-enoate? |
| A: Related upstream materials(CAS) of hex-5-enyl undec-10-enoate: 821-41-0;38460-95-6. |
| Q: What is the molecular weight of hex-5-enyl undec-10-enoate? |
| A: Molecular weight of hex-5-enyl undec-10-enoate is 266.41900. |
| Q: What is the Chinese name of 76293-70-4? |
| A: Chinese name of 76293-70-4 is 76293-70-4. |
| Q: What is the polar surface area (PSA) of hex-5-enyl undec-10-enoate? |
| A: Polar surface area (PSA) of hex-5-enyl undec-10-enoate is 26.30000. |