Timefurone structure
|
Common Name | Timefurone | ||
|---|---|---|---|---|
| CAS Number | 76301-19-4 | Molecular Weight | 306.33400 | |
| Density | 1.322g/cm3 | Boiling Point | 486.1ºC at 760 mmHg | |
| Molecular Formula | C15H14O5S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 247.8ºC | |
| Name | 4,9-dimethoxy-7-(methylsulfanylmethyl)furo[3,2-g]chromen-5-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.322g/cm3 |
|---|---|
| Boiling Point | 486.1ºC at 760 mmHg |
| Molecular Formula | C15H14O5S |
| Molecular Weight | 306.33400 |
| Flash Point | 247.8ºC |
| Exact Mass | 306.05600 |
| PSA | 87.11000 |
| LogP | 3.41940 |
| Index of Refraction | 1.612 |
| InChIKey | SWKFRGASPZPNBV-UHFFFAOYSA-N |
| SMILES | COc1c2occc2c(OC)c2c(=O)cc(CSC)oc12 |
| HS Code | 2932999099 |
|---|
|
~%
Timefurone CAS#:76301-19-4 |
| Literature: Gammill, Ronald B. Journal of Organic Chemistry, 1984 , vol. 49, # 26 p. 5035 - 5041 |
|
~%
Timefurone CAS#:76301-19-4 |
| Literature: Gammill; Bell; Bisaha; Wilson Journal of Medicinal Chemistry, 1990 , vol. 33, # 10 p. 2685 - 2687 |
| Precursor 3 | |
|---|---|
| DownStream 1 | |
| HS Code | 2932999099 |
|---|---|
| Summary | 2932999099. other heterocyclic compounds with oxygen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| Timefurona |
| 4,9-Dimethoxy-7-[(methylthio)methyl]-5H-furo[3,2-g]benzopyran-5-one |
| Timefurone |
| Timefurona [Spanish] |
| furochromone |
| Timefuronum [Latin] |
| Timefurone (USAN/INN) |
| Timefuronum |
| 4,9-Dimethoxy-7-<methylthio)methyl>-5H-furo<3,2-g><1>benzopyran-5-one |