N-[2-(1,3-benzodioxol-5-yl)-1-phenylethyl]acetamide structure
|
Common Name | N-[2-(1,3-benzodioxol-5-yl)-1-phenylethyl]acetamide | ||
|---|---|---|---|---|
| CAS Number | 76306-61-1 | Molecular Weight | 283.32200 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C17H17NO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | N-[2-(1,3-benzodioxol-5-yl)-1-phenylethyl]acetamide |
|---|
| Molecular Formula | C17H17NO3 |
|---|---|
| Molecular Weight | 283.32200 |
| Exact Mass | 283.12100 |
| PSA | 51.05000 |
| LogP | 3.67550 |
| InChIKey | QPPSUZJZFZQSMD-UHFFFAOYSA-N |
| SMILES | CC(=O)NC(Cc1ccc2c(c1)OCO2)c1ccccc1 |
|
~%
N-[2-(1,3-benzo... CAS#:76306-61-1 |
| Literature: Dey; Ramanathan Proceedings of the National Institute of Sciences of India, 1943 , vol. 9, p. 193,222 |
| Precursor 1 | |
|---|---|
| DownStream 1 | |