Melissoidesin P
Modify Date: 2026-05-08 23:20:08
Melissoidesin P structure
|
Common Name | Melissoidesin P | ||
|---|---|---|---|---|
| CAS Number | 763095-86-9 | Molecular Weight | 394.5 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C22H34O6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | Melissoidesin P |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C22H34O6 |
|---|---|
| Molecular Weight | 394.5 |
| InChIKey | LUIISUPYQATGOA-PTSBWHOISA-N |
| SMILES | CC(=O)O[C@@H]1[C@H]2[C@@](CC[C@@H](C2(C)C)O)([C@@H]3[C@H](C[C@@H]4C[C@@]3([C@H]1O)[C@@H](C4=C)O)O)C |
This table contains target information, in‑vitro & in‑vivo assay data for this compound.
|
Name: Cytotoxicity against human BGC823 cells
Source: ChEMBL
Target: BGC-823
External Id: CHEMBL965889
|
Total 1, Current Page 1 of 1
1
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the CAS number of Melissoidesin P? |
| A: CAS number of Melissoidesin P is 763095-86-9. |
| Q: What is the molecular weight of Melissoidesin P? |
| A: Molecular weight of Melissoidesin P is 394.5. |
| Q: What is the SMILES notation of Melissoidesin P? |
| A: SMILES notation of Melissoidesin P is CC(=O)O[C@@H]1[C@H]2[C@@](CC[C@@H](C2(C)C)O)([C@@H]3[C@H](C[C@@H]4C[C@@]3([C@H]1O)[C@@H](C4=C)O)O)C. |
| Q: What is the English name of Melissoidesin P? |
| A: The English name of Melissoidesin P is Melissoidesin P. |
| Q: What is the molecular formula of Melissoidesin P? |
| A: Molecular formula of Melissoidesin P is C22H34O6. |
| Q: What is the InChIKey of Melissoidesin P? |
| A: InChIKey of Melissoidesin P is LUIISUPYQATGOA-PTSBWHOISA-N. |
| Q: What is the Chinese name of 763095-86-9? |
| A: Chinese name of 763095-86-9 is 763095-86-9. |