N,N,5-trimethyl-2,2-dioxo-6-phenyl-3,4-dihydrooxathiin-4-amine structure
|
Common Name | N,N,5-trimethyl-2,2-dioxo-6-phenyl-3,4-dihydrooxathiin-4-amine | ||
|---|---|---|---|---|
| CAS Number | 76312-36-2 | Molecular Weight | 267.34400 | |
| Density | 1.25g/cm3 | Boiling Point | 425.5ºC at 760 mmHg | |
| Molecular Formula | C13H17NO3S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 211.1ºC | |
| Name | N,N,5-trimethyl-2,2-dioxo-6-phenyl-3,4-dihydrooxathiin-4-amine |
|---|
| Density | 1.25g/cm3 |
|---|---|
| Boiling Point | 425.5ºC at 760 mmHg |
| Molecular Formula | C13H17NO3S |
| Molecular Weight | 267.34400 |
| Flash Point | 211.1ºC |
| Exact Mass | 267.09300 |
| PSA | 54.99000 |
| LogP | 2.78860 |
| Index of Refraction | 1.583 |
| InChIKey | GWTIZKMKCVCGOF-UHFFFAOYSA-N |
| SMILES | CC1=C(c2ccccc2)OS(=O)(=O)CC1N(C)C |
|
~43%
N,N,5-trimethyl... CAS#:76312-36-2 |
| Literature: Bargagna, Alberto; Schenone, Pietro; Bondavalli, Francesco; Longobardi, Mario Journal of Heterocyclic Chemistry, 1980 , vol. 17, p. 1201 - 1206 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |