3,3-dichloro-4-(diphenylamino)-5-methyl-6-phenyl-4H-pyran-2-one structure
|
Common Name | 3,3-dichloro-4-(diphenylamino)-5-methyl-6-phenyl-4H-pyran-2-one | ||
|---|---|---|---|---|
| CAS Number | 76312-40-8 | Molecular Weight | 424.31900 | |
| Density | 1.34g/cm3 | Boiling Point | 589.4ºC at 760 mmHg | |
| Molecular Formula | C24H19Cl2NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 310.3ºC | |
| Name | 3,3-dichloro-5-methyl-6-phenyl-4-(N-phenylanilino)-4H-pyran-2-one |
|---|
| Density | 1.34g/cm3 |
|---|---|
| Boiling Point | 589.4ºC at 760 mmHg |
| Molecular Formula | C24H19Cl2NO2 |
| Molecular Weight | 424.31900 |
| Flash Point | 310.3ºC |
| Exact Mass | 423.07900 |
| PSA | 29.54000 |
| LogP | 6.35520 |
| Index of Refraction | 1.663 |
| InChIKey | XUGWTOHBVYVQNO-UHFFFAOYSA-N |
| SMILES | CC1=C(c2ccccc2)OC(=O)C(Cl)(Cl)C1N(c1ccccc1)c1ccccc1 |
|
~%
3,3-dichloro-4-... CAS#:76312-40-8 |
| Literature: Bargagna, Alberto; Schenone, Pietro; Bondavalli, Francesco; Longobardi, Mario Journal of Heterocyclic Chemistry, 1980 , vol. 17, p. 1201 - 1206 |
| Precursor 1 | |
|---|---|
| DownStream 1 | |